EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:43291 - L-erythro-isocitric acid
| Formula | C6H8O7 |
| Net Charge | 0 |
| Average Mass | 192.123 |
| Monoisotopic Mass | 192.02700 |
| SMILES | O=C(O)C[C@@H](C(=O)O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13)/t2-,4-/m1/s1 |
| InChIKey | ODBLHEXUDAPZAU-VVJJHMBFSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-erythro-isocitric acid (CHEBI:43291) is a isocitric acid (CHEBI:30887) |
| L-erythro-isocitric acid (CHEBI:43291) is conjugate acid of L-erythro-isocitrate(3−) (CHEBI:30897) |
| L-erythro-isocitric acid (CHEBI:43291) is enantiomer of D-erythro-isocitric acid (CHEBI:160) |
| Incoming Relation(s) |
| L-erythro-isocitrate(3−) (CHEBI:30897) is conjugate base of L-erythro-isocitric acid (CHEBI:43291) |
| D-erythro-isocitric acid (CHEBI:160) is enantiomer of L-erythro-isocitric acid (CHEBI:43291) |
| IUPAC Names |
|---|
| (1R,2R)-1-hydroxypropane-1,2,3-tricarboxylic acid |
| 3-carboxy-3,4-dideoxy-D-erythro-pentaric acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1727949 | Beilstein |
| Reaxys:1727949 | Reaxys |