EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H12O7 |
| Net Charge | 0 |
| Average Mass | 352.298 |
| Monoisotopic Mass | 352.05830 |
| SMILES | COc1cc2cc(Oc3ccc4ccc(=O)oc4c3)c(=O)oc2cc1O |
| InChI | InChI=1S/C19H12O7/c1-23-16-6-11-7-17(19(22)26-15(11)9-13(16)20)24-12-4-2-10-3-5-18(21)25-14(10)8-12/h2-9,20H,1H3 |
| InChIKey | JRHMMVBOTXEHGJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| daphnoretin (CHEBI:4324) has functional parent coumarin (CHEBI:28794) |
| daphnoretin (CHEBI:4324) has role antineoplastic agent (CHEBI:35610) |
| daphnoretin (CHEBI:4324) has role antiviral agent (CHEBI:22587) |
| daphnoretin (CHEBI:4324) has role metabolite (CHEBI:25212) |
| daphnoretin (CHEBI:4324) is a aromatic ether (CHEBI:35618) |
| daphnoretin (CHEBI:4324) is a hydroxycoumarin (CHEBI:37912) |
| IUPAC Name |
|---|
| 7-hydroxy-6-methoxy-3-[(2-oxo-2H-chromen-7-yl)oxy]-2H-chromen-2-one |
| Synonym | Source |
|---|---|
| Daphnoretin | KEGG COMPOUND |
| Citations |
|---|