EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H26FN3O6 |
| Net Charge | 0 |
| Average Mass | 507.518 |
| Monoisotopic Mass | 507.18056 |
| SMILES | COc1ccc(O)c(C(=O)c2ccc(C(=O)O[C@@H]3CCCNC[C@H]3NC(=O)c3ccncc3)cc2)c1F |
| InChI | InChI=1S/C27H26FN3O6/c1-36-22-9-8-20(32)23(24(22)28)25(33)16-4-6-18(7-5-16)27(35)37-21-3-2-12-30-15-19(21)31-26(34)17-10-13-29-14-11-17/h4-11,13-14,19,21,30,32H,2-3,12,15H2,1H3,(H,31,34)/t19-,21-/m1/s1 |
| InChIKey | VYPRIFLEMOQRJK-TZIWHRDSSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that specifically blocks the action of non-specific protein-tyrosine kinase (EC 2.7.10.2). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| RO0480500-002 (CHEBI:43183) has role EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor (CHEBI:76617) |
| RO0480500-002 (CHEBI:43183) is a aromatic ketone (CHEBI:76224) |
| RO0480500-002 (CHEBI:43183) is a azepanes (CHEBI:46986) |
| RO0480500-002 (CHEBI:43183) is a benzoate ester (CHEBI:36054) |
| RO0480500-002 (CHEBI:43183) is a monofluorobenzenes (CHEBI:83575) |
| RO0480500-002 (CHEBI:43183) is a monomethoxybenzene (CHEBI:25235) |
| RO0480500-002 (CHEBI:43183) is a phenols (CHEBI:33853) |
| RO0480500-002 (CHEBI:43183) is a pyridinecarboxamide (CHEBI:25529) |
| RO0480500-002 (CHEBI:43183) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (3R,4R)-3-[(pyridin-4-ylcarbonyl)amino]azepan-4-yl 4-(2-fluoro-6-hydroxy-3-methoxybenzoyl)benzoate |
| Synonyms | Source |
|---|---|
| (3R,4R)-3-[(pyridin-4-ylcarbonyl)amino]azepan-4-yl 4-[(2-fluoro-6-hydroxy-3-methoxyphenyl)carbonyl]benzoate | PDBeChem |
| (4R)-4-(2-fluoro-6-hydroxy-3-methoxy-benzoyl)-benzoic acid (3R)-3-[(pyridine-4-carbonyl)amino]-azepan-4-yl ester | PDBeChem |
| RO0480500-002 | ChEBI |
| RO48 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| I01 | PDBeChem |
| Citations |
|---|