EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O5 |
| Net Charge | 0 |
| Average Mass | 212.201 |
| Monoisotopic Mass | 212.06847 |
| SMILES | COc1cc(C(=O)CO)cc(OC)c1O |
| InChI | InChI=1S/C10H12O5/c1-14-8-3-6(7(12)5-11)4-9(15-2)10(8)13/h3-4,11,13H,5H2,1-2H3 |
| InChIKey | ZTBAPEIDNUHRNC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. phytoalexin A toxin made by a plant that acts against an organism attacking it. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| danielone (CHEBI:4316) has role antifungal agent (CHEBI:35718) |
| danielone (CHEBI:4316) has role phytoalexin (CHEBI:26115) |
| danielone (CHEBI:4316) has role plant metabolite (CHEBI:76924) |
| danielone (CHEBI:4316) is a aromatic ketone (CHEBI:76224) |
| danielone (CHEBI:4316) is a dimethoxybenzene (CHEBI:51681) |
| danielone (CHEBI:4316) is a phenols (CHEBI:33853) |
| danielone (CHEBI:4316) is a primary alcohol (CHEBI:15734) |
| danielone (CHEBI:4316) is a primary α-hydroxy ketone (CHEBI:139590) |
| IUPAC Name |
|---|
| 2-hydroxy-1-(4-hydroxy-3,5-dimethoxyphenyl)ethanone |
| Synonyms | Source |
|---|---|
| 2,4'-dihydroxy-3',5'-dimethoxyacetophenone | ChEBI |
| 3',5'-dimethoxy-4'-hydroxy-(2-hydroxy)acetophenone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00002692 | KNApSAcK |
| C10674 | KEGG COMPOUND |
| Danielone | Wikipedia |
| HMDB0031704 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3096770 | Reaxys |
| CAS:90426-22-5 | ChemIDplus |
| CAS:90426-22-5 | KEGG COMPOUND |
| Citations |
|---|