EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13NO2 |
| Net Charge | 0 |
| Average Mass | 179.219 |
| Monoisotopic Mass | 179.09463 |
| SMILES | N[C@@H](CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C10H13NO2/c11-9(10(12)13)7-6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13)/t9-/m0/s1 |
| InChIKey | JTTHKOPSMAVJFE-VIFPVBQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nostoc punctiforme (ncbitaxon:63737) | - | PubMed (23354699) | Strain: PCC 73102 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-homophenylalanine (CHEBI:43103) has role bacterial metabolite (CHEBI:76969) |
| L-homophenylalanine (CHEBI:43103) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-phenylbutanoic acid |
| Synonyms | Source |
|---|---|
| L-HPA | ChEBI |
| L-hph | MetaCyc |
| homophenylalanine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HPE | PDBeChem |
| C17235 | KEGG COMPOUND |
| CPD-15322 | MetaCyc |
| AU2010269286 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3201289 | Reaxys |
| CAS:943-73-7 | KEGG COMPOUND |
| CAS:943-73-7 | ChemIDplus |
| Citations |
|---|