EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16N2O4S |
| Net Charge | 0 |
| Average Mass | 308.359 |
| Monoisotopic Mass | 308.08308 |
| SMILES | Cc1c(Sc2ccccc2)n(COCCO)c(=O)nc1=O |
| InChI | InChI=1S/C14H16N2O4S/c1-10-12(18)15-14(19)16(9-20-8-7-17)13(10)21-11-5-3-2-4-6-11/h2-6,17H,7-9H2,1H3,(H,15,18,19) |
| InChIKey | HDMHBHNRWDNNCD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[(2-hydroxyethoxy)methyl]-6-(phenylsulfanyl)thymine (CHEBI:43060) has functional parent thymine (CHEBI:17821) |
| 1-[(2-hydroxyethoxy)methyl]-6-(phenylsulfanyl)thymine (CHEBI:43060) has role antiviral drug (CHEBI:36044) |
| 1-[(2-hydroxyethoxy)methyl]-6-(phenylsulfanyl)thymine (CHEBI:43060) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| 1-[(2-hydroxyethoxy)methyl]-6-(phenylsulfanyl)thymine (CHEBI:43060) is a aryl sulfide (CHEBI:35683) |
| 1-[(2-hydroxyethoxy)methyl]-6-(phenylsulfanyl)thymine (CHEBI:43060) is a primary alcohol (CHEBI:15734) |
| 1-[(2-hydroxyethoxy)methyl]-6-(phenylsulfanyl)thymine (CHEBI:43060) is a pyrimidone (CHEBI:38337) |
| IUPAC Name |
|---|
| 1-[(2-hydroxyethoxy)methyl]-5-methyl-6-(phenylsulfanyl)pyrimidine-2,4(1H,3H)-dione |
| Synonyms | Source |
|---|---|
| 1-(2-HYDROXYETHYLOXYMETHYL)-6-PHENYL THIOTHYMINE | PDBeChem |
| 1-[(2-hydroxyethoxy)methyl]-6-phenylthiothymine | ChEBI |
| HEPT | ChEBI |
| 1-[(2-hydroxyethoxy)methyl]-6-(phenylthio)thymine | ChEBI |
| 6-Hept | ChemIDplus |
| HMPTT | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HEF | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4271052 | Reaxys |
| CAS:123027-56-5 | ChemIDplus |
| Citations |
|---|