EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:43040 - hadacidin
| Formula | C3H5NO4 |
| Net Charge | 0 |
| Average Mass | 119.076 |
| Monoisotopic Mass | 119.02186 |
| SMILES | O=CN(O)CC(=O)O |
| InChI | InChI=1S/C3H5NO4/c5-2-4(8)1-3(6)7/h2,8H,1H2,(H,6,7) |
| InChIKey | URJHVPKUWOUENU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hadacidin (CHEBI:43040) has role Penicillium metabolite (CHEBI:76964) |
| hadacidin (CHEBI:43040) has role antimicrobial agent (CHEBI:33281) |
| hadacidin (CHEBI:43040) has role antineoplastic agent (CHEBI:35610) |
| hadacidin (CHEBI:43040) has role teratogenic agent (CHEBI:50905) |
| hadacidin (CHEBI:43040) is a N-hydroxy-α-amino-acid (CHEBI:50760) |
| hadacidin (CHEBI:43040) is a aldehyde (CHEBI:17478) |
| hadacidin (CHEBI:43040) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| N-formyl-N-hydroxyglycine |
| Synonyms | Source |
|---|---|
| HADACIDIN | PDBeChem |
| N-hydroxyformamidoacetic acid | ChEBI |
| N-formyl-N- hydroxyaminoacetic acid | ChEBI |
| N-formyl hydroxyaminoacetic acid | ChemIDplus |
| [formyl(hydroxy)amino]acetic acid | IUPAC |
| Citations |
|---|