EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:43040 - hadacidin
| Formula | C3H5NO4 |
| Net Charge | 0 |
| Average Mass | 119.076 |
| Monoisotopic Mass | 119.02186 |
| SMILES | O=CN(O)CC(=O)O |
| InChI | InChI=1S/C3H5NO4/c5-2-4(8)1-3(6)7/h2,8H,1H2,(H,6,7) |
| InChIKey | URJHVPKUWOUENU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hadacidin (CHEBI:43040) has role Penicillium metabolite (CHEBI:76964) |
| hadacidin (CHEBI:43040) has role antimicrobial agent (CHEBI:33281) |
| hadacidin (CHEBI:43040) has role antineoplastic agent (CHEBI:35610) |
| hadacidin (CHEBI:43040) has role teratogenic agent (CHEBI:50905) |
| hadacidin (CHEBI:43040) is a N-hydroxy-α-amino-acid (CHEBI:50760) |
| hadacidin (CHEBI:43040) is a aldehyde (CHEBI:17478) |
| hadacidin (CHEBI:43040) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| N-formyl-N-hydroxyglycine |
| Synonyms | Source |
|---|---|
| N-formyl-N- hydroxyaminoacetic acid | ChEBI |
| N-formyl hydroxyaminoacetic acid | ChemIDplus |
| N-hydroxyformamidoacetic acid | ChEBI |
| [formyl(hydroxy)amino]acetic acid | IUPAC |
| HADACIDIN | PDBeChem |
| Citations |
|---|