EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18ClF2N3O3 |
| Net Charge | 0 |
| Average Mass | 409.820 |
| Monoisotopic Mass | 409.10048 |
| SMILES | N[C@@H]1CN(c2c(F)cc3c(=O)c(C(=O)O)cn([C@@H]4C[C@@H]4F)c3c2Cl)CC12CC2 |
| InChI | InChI=1S/C19H18ClF2N3O3/c20-14-15-8(17(26)9(18(27)28)5-25(15)12-4-10(12)21)3-11(22)16(14)24-6-13(23)19(7-24)1-2-19/h3,5,10,12-13H,1-2,4,6-7,23H2,(H,27,28)/t10-,12+,13+/m0/s1 |
| InChIKey | PNUZDKCDAWUEGK-CYZMBNFOSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sitafloxacin (CHEBI:4304) is a fluoroquinolone antibiotic (CHEBI:87211) |
| Sitafloxacin (CHEBI:4304) is a quinolines (CHEBI:26513) |
| Sitafloxacin (CHEBI:4304) is a quinolone antibiotic (CHEBI:86324) |
| Synonyms | Source |
|---|---|
| DU-6859 | KEGG COMPOUND |
| DU-6859 | DrugCentral |
| gracevit | DrugCentral |
| Sitafloxacin | KEGG COMPOUND |
| sitafloxacin hydrate | DrugCentral |