EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10Cl2N2O2 |
| Net Charge | 0 |
| Average Mass | 285.130 |
| Monoisotopic Mass | 284.01193 |
| SMILES | Cc1nn(C)c(O)c1C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H10Cl2N2O2/c1-6-10(12(18)16(2)15-6)11(17)8-4-3-7(13)5-9(8)14/h3-5,18H,1-2H3 |
| InChIKey | XMSHRLOQLUNKSN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | carotenoid biosynthesis inhibitor Any pathway inhibitor that acts on the carotenoid biosynthesis pathway. EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor An EC 1.13.11.* (oxidoreductase acting on single donors and incorporating 2 atoms of oxygen) inhibitor that interferes with the activity of 4-hydroxyphenylpyruvate dioxygenase (EC 1.13.11.27). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| destosyl pyrazolate (CHEBI:4302) has role agrochemical (CHEBI:33286) |
| destosyl pyrazolate (CHEBI:4302) has role carotenoid biosynthesis inhibitor (CHEBI:138208) |
| destosyl pyrazolate (CHEBI:4302) has role EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor (CHEBI:38317) |
| destosyl pyrazolate (CHEBI:4302) has role herbicide (CHEBI:24527) |
| destosyl pyrazolate (CHEBI:4302) is a acetophenones (CHEBI:22187) |
| destosyl pyrazolate (CHEBI:4302) is a dichlorobenzene (CHEBI:23697) |
| destosyl pyrazolate (CHEBI:4302) is a organic hydroxy compound (CHEBI:33822) |
| destosyl pyrazolate (CHEBI:4302) is a pyrazole pesticide (CHEBI:38601) |
| destosyl pyrazolate (CHEBI:4302) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| (2,4-dichlorophenyl)(5-hydroxy-1,3-dimethyl-1H-pyrazol-4-yl)methanone |
| Synonyms | Source |
|---|---|
| 1,3-dimethyl-4-(2,4-dichlorobenzoyl)-1H-pyrazole-5-ol | ChEBI |
| 1,3-dimethyl-4-(2,4-dichlorobenzoyl)-5-hydroxypyrazole | ChEBI |
| (2,4-dichlorophenyl)(5-hydroxy-1,3-dimethyl-1H-pyrazol-4-yl)methanone | KEGG COMPOUND |
| 4-(2,4-Dichlorobenzoyl)-1,3-dimethyl-1H-pyrazol-5-ol | ChEBI |
| 4-(2,4-Dichlorobenzoyl)-1,3-dimethyl-5-hydroxypyrazole | KEGG COMPOUND |
| Destosyl pyrazolate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C11122 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11718474 | Reaxys |
| CAS:58010-98-3 | ChemIDplus |
| CAS:58010-98-3 | KEGG COMPOUND |
| Citations |
|---|