EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:43012 - phenyl [1-(N-succinylamino)pentyl]phosphonate
| Formula | C15H22NO6P |
| Net Charge | 0 |
| Average Mass | 343.316 |
| Monoisotopic Mass | 343.11847 |
| SMILES | CCCC[C@H](NC(=O)CCC(=O)O)[P@@](=O)(O)Oc1ccccc1 |
| InChI | InChI=1S/C15H22NO6P/c1-2-3-9-14(16-13(17)10-11-15(18)19)23(20,21)22-12-7-5-4-6-8-12/h4-8,14H,2-3,9-11H2,1H3,(H,16,17)(H,18,19)(H,20,21)/t14-/m1/s1 |
| InChIKey | FJQWWGCHPFSERW-CQSZACIVSA-N |
| Roles Classification |
|---|
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenyl [1-(N-succinylamino)pentyl]phosphonate (CHEBI:43012) has functional parent succinic acid (CHEBI:15741) |
| phenyl [1-(N-succinylamino)pentyl]phosphonate (CHEBI:43012) has role hapten (CHEBI:59174) |
| phenyl [1-(N-succinylamino)pentyl]phosphonate (CHEBI:43012) is a dicarboxylic acid monoamide (CHEBI:35735) |
| phenyl [1-(N-succinylamino)pentyl]phosphonate (CHEBI:43012) is a organic phosphonate (CHEBI:37592) |
| IUPAC Name |
|---|
| 4-({(1R)-1-[(R)-hydroxy(phenoxy)phosphoryl]pentyl}amino)-4-oxobutanoic acid |
| Synonym | Source |
|---|---|
| phenyl[1-(n-succinylamino)pentyl]phosphonate | ChEBI |
| Citations |
|---|