EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:42944 - galanthamine
| Formula | C17H21NO3 |
| Net Charge | 0 |
| Average Mass | 287.359 |
| Monoisotopic Mass | 287.15214 |
| SMILES | [H][C@]12C[C@@H](O)C=C[C@]13CCN(C)Cc1ccc(OC)c(c13)O2 |
| InChI | InChI=1S/C17H21NO3/c1-18-8-7-17-6-5-12(19)9-14(17)21-16-13(20-2)4-3-11(10-18)15(16)17/h3-6,12,14,19H,7-10H2,1-2H3/t12-,14-,17-/m0/s1 |
| InChIKey | ASUTZQLVASHGKV-JDFRZJQESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. anti-obesity agent Any substance which is used to reduce or control weight. EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | vasoconstrictor agent Drug used to cause constriction of the blood vessels. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. nootropic agent Any compound that improves mental functions such as cognition, memory, intelligence, motivation, attention, and concentration. antidote to curare poisoning A role borne by a molecule that acts to counteract or neutralize the deleterious effects of curare. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| galanthamine (CHEBI:42944) has role anti-HIV agent (CHEBI:64946) |
| galanthamine (CHEBI:42944) has role anti-obesity agent (CHEBI:74518) |
| galanthamine (CHEBI:42944) has role antidepressant (CHEBI:35469) |
| galanthamine (CHEBI:42944) has role antidote to curare poisoning (CHEBI:74530) |
| galanthamine (CHEBI:42944) has role antipsychotic agent (CHEBI:35476) |
| galanthamine (CHEBI:42944) has role anxiolytic drug (CHEBI:35474) |
| galanthamine (CHEBI:42944) has role cholinergic drug (CHEBI:38323) |
| galanthamine (CHEBI:42944) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| galanthamine (CHEBI:42944) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| galanthamine (CHEBI:42944) has role nootropic agent (CHEBI:66980) |
| galanthamine (CHEBI:42944) has role plant metabolite (CHEBI:76924) |
| galanthamine (CHEBI:42944) has role vasoconstrictor agent (CHEBI:50514) |
| galanthamine (CHEBI:42944) is a benzazepine alkaloid (CHEBI:38523) |
| galanthamine (CHEBI:42944) is a benzazepine alkaloid fundamental parent (CHEBI:38527) |
| galanthamine (CHEBI:42944) is a organic heterotetracyclic compound (CHEBI:38163) |
| galanthamine (CHEBI:42944) is a tertiary amino compound (CHEBI:50996) |
| galanthamine (CHEBI:42944) is conjugate base of galanthamine(1+) (CHEBI:178021) |
| Incoming Relation(s) |
| galanthamine(1+) (CHEBI:178021) is conjugate acid of galanthamine (CHEBI:42944) |
| IUPAC Name |
|---|
| galanthamine |
| INNs | Source |
|---|---|
| galantamina | WHO MedNet |
| galantamine | WHO MedNet |
| galantamine | WHO MedNet |
| galanthaminum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (4aS,6R,8aS)-3-methoxy-11-methyl-5,6,9,10,11,12-hexahydro-4aH-[1]benzofuro[3a,3,2-ef][2]benzazepin-6-ol | IUPAC |
| (−)-galantamine | DrugCentral |
| galantamine | ChEMBL |
| (−)-galanthamine | PDBeChem |
| Galanthamine | KEGG COMPOUND |
| NSC-100058 | ChEMBL |
| Brand Names | Source |
|---|---|
| Acumor xl | ChEMBL |
| Consion xl | ChEMBL |
| Elmino xl | ChEMBL |
| Galsya xl | ChEMBL |
| Galzemic xl | ChEMBL |
| Gatalin xl | ChEMBL |
| Citations |
|---|