EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21NO3 |
| Net Charge | 0 |
| Average Mass | 287.359 |
| Monoisotopic Mass | 287.15214 |
| SMILES | [H][C@]12C[C@@H](O)C=C[C@]13CCN(C)Cc1ccc(OC)c(c13)O2 |
| InChI | InChI=1S/C17H21NO3/c1-18-8-7-17-6-5-12(19)9-14(17)21-16-13(20-2)4-3-11(10-18)15(16)17/h3-6,12,14,19H,7-10H2,1-2H3/t12-,14-,17-/m0/s1 |
| InChIKey | ASUTZQLVASHGKV-JDFRZJQESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. antidote to curare poisoning A role borne by a molecule that acts to counteract or neutralize the deleterious effects of curare. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| galanthamine (CHEBI:42944) has role antidote to curare poisoning (CHEBI:74530) |
| galanthamine (CHEBI:42944) has role cholinergic drug (CHEBI:38323) |
| galanthamine (CHEBI:42944) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| galanthamine (CHEBI:42944) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| galanthamine (CHEBI:42944) has role plant metabolite (CHEBI:76924) |
| galanthamine (CHEBI:42944) is a benzazepine alkaloid (CHEBI:38523) |
| galanthamine (CHEBI:42944) is a benzazepine alkaloid fundamental parent (CHEBI:38527) |
| galanthamine (CHEBI:42944) is a organic heterotetracyclic compound (CHEBI:38163) |
| galanthamine (CHEBI:42944) is a tertiary amino compound (CHEBI:50996) |
| galanthamine (CHEBI:42944) is conjugate base of galanthamine(1+) (CHEBI:178021) |
| Incoming Relation(s) |
| galanthamine(1+) (CHEBI:178021) is conjugate acid of galanthamine (CHEBI:42944) |
| IUPAC Name |
|---|
| galanthamine |
| INNs | Source |
|---|---|
| galantamina | WHO MedNet |
| galantamine | WHO MedNet |
| galantamine | WHO MedNet |
| galanthaminum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (4aS,6R,8aS)-3-methoxy-11-methyl-5,6,9,10,11,12-hexahydro-4aH-[1]benzofuro[3a,3,2-ef][2]benzazepin-6-ol | IUPAC |
| (−)-galantamine | DrugCentral |
| (−)-galanthamine | PDBeChem |
| Galanthamine | KEGG COMPOUND |
| Citations |
|---|