EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16NO16S2 |
| Net Charge | -3 |
| Average Mass | 494.385 |
| Monoisotopic Mass | 493.99270 |
| SMILES | O=C([O-])C1=C[C@H](O)[C@@H](OS(=O)(=O)[O-])[C@H](O[C@H]2[C@H](O)[C@@H](NS(=O)(=O)[O-])[C@@H](O)O[C@@H]2CO)O1 |
| InChI | InChI=1S/C12H19NO16S2/c14-2-5-9(7(16)6(11(19)26-5)13-30(20,21)22)28-12-8(29-31(23,24)25)3(15)1-4(27-12)10(17)18/h1,3,5-9,11-16,19H,2H2,(H,17,18)(H,20,21,22)(H,23,24,25)/p-3/t3-,5+,6+,7+,8+,9+,11-,12-/m0/s1 |
| InChIKey | GSYQGRODWXMUOO-GYBHJADLSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| HP_dp02_0008(3−) (CHEBI:42917) is a carbohydrate acid derivative anion (CHEBI:63551) |
| HP_dp02_0008(3−) (CHEBI:42917) is a organic sulfamate oxoanion (CHEBI:61660) |
| HP_dp02_0008(3−) (CHEBI:42917) is a organosulfate oxoanion (CHEBI:58958) |
| HP_dp02_0008(3−) (CHEBI:42917) is conjugate base of HP_dp02_0008 (CHEBI:138684) |
| Incoming Relation(s) |
| HP_dp02_0008 (CHEBI:138684) is conjugate acid of HP_dp02_0008(3−) (CHEBI:42917) |
| IUPAC Name |
|---|
| 2-deoxy-4-O-(4-deoxy-2-O-sulfonato-α-L-threo-hex-4-enopyranuronosyl)-2-(sulfonatoamino)-α-D-glucopyranose |