EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12N2O2 |
| Net Charge | 0 |
| Average Mass | 132.163 |
| Monoisotopic Mass | 132.08988 |
| SMILES | C[C@H](N)C[C@@H](N)C(=O)O |
| InChI | InChI=1S/C5H12N2O2/c1-3(6)2-4(7)5(8)9/h3-4H,2,6-7H2,1H3,(H,8,9)/t3-,4+/m0/s1 |
| InChIKey | PCEJMSIIDXUDSN-IUYQGCFVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,4S)-2,4-diaminopentanoic acid (CHEBI:4280) is a 2,4-diaminopentanoic acid (CHEBI:904) |
| (2R,4S)-2,4-diaminopentanoic acid (CHEBI:4280) is conjugate acid of (2R,4S)-2,4-diaminopentanoate (CHEBI:15601) |
| (2R,4S)-2,4-diaminopentanoic acid (CHEBI:4280) is conjugate base of (2R,4S)-2,4-diazaniumylpentanoate (CHEBI:58697) |
| Incoming Relation(s) |
| (2R,4S)-2,4-diazaniumylpentanoate (CHEBI:58697) is conjugate acid of (2R,4S)-2,4-diaminopentanoic acid (CHEBI:4280) |
| (2R,4S)-2,4-diaminopentanoate (CHEBI:15601) is conjugate base of (2R,4S)-2,4-diaminopentanoic acid (CHEBI:4280) |
| IUPAC Name |
|---|
| (2R,4S)-2,4-diaminopentanoic acid |
| Synonyms | Source |
|---|---|
| (2R,4S)-2,4-Diaminopentanoate | KEGG COMPOUND |
| D-threo-2,4-Diaminopentanoate | KEGG COMPOUND |
| D-threo-2,4-Diaminopentanoate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C03943 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7110771 | Beilstein |