EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H40N4O10 |
| Net Charge | 0 |
| Average Mass | 496.558 |
| Monoisotopic Mass | 496.27444 |
| SMILES | CN[C@@H]1[C@@H](O)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](C(C)O)[C@@H](O)[C@H](O)[C@H]3N)[C@@H](N)C[C@H]2N)OC[C@]1(C)O |
| InChI | InChI=1S/C20H40N4O10/c1-6(25)14-11(27)10(26)9(23)18(32-14)33-15-7(21)4-8(22)16(12(15)28)34-19-13(29)17(24-3)20(2,30)5-31-19/h6-19,24-30H,4-5,21-23H2,1-3H3/t6?,7-,8+,9+,10+,11-,12-,13+,14+,15+,16-,17+,18+,19+,20-/m0/s1 |
| InChIKey | BRZYSWJRSDMWLG-CAXSIQPQSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. coccidiostat An agent useful in the treatment or prevention of coccidiosis in man or animals. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antiparasitic agent A substance used to treat or prevent parasitic infections. coccidiostat An agent useful in the treatment or prevention of coccidiosis in man or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| geneticin (CHEBI:42768) has role antiinfective agent (CHEBI:35441) |
| geneticin (CHEBI:42768) has role antiparasitic agent (CHEBI:35442) |
| geneticin (CHEBI:42768) has role antiprotozoal drug (CHEBI:35820) |
| geneticin (CHEBI:42768) has role coccidiostat (CHEBI:35818) |
| geneticin (CHEBI:42768) is a aminoglycoside antibiotic (CHEBI:22507) |
| geneticin (CHEBI:42768) is conjugate base of geneticin cation(4+) (CHEBI:195256) |
| Incoming Relation(s) |
| geneticin cation(4+) (CHEBI:195256) is conjugate acid of geneticin (CHEBI:42768) |
| IUPAC Name |
|---|
| (1R,2S,3S,4R,6S)-4,6-diamino-3-[3-deoxy-4-C-methyl-3-(methylamino)-β-L-arabinopyranosyloxy]-2-hydroxycyclohexyl 2-amino-2,7-dideoxy-D-glycero-α-D-gluco-heptopyranoside |
| Synonyms | Source |
|---|---|
| antibiotic G 418 | ChemIDplus |
| G 418 | ChemIDplus |
| G418 | KEGG COMPOUND |
| Geneticin | KEGG COMPOUND |
| GENETICIN | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1669188 | Beilstein |
| CAS:49863-47-0 | ChemIDplus |
| CAS:49863-47-0 | KEGG COMPOUND |