EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10N4 |
| Net Charge | 0 |
| Average Mass | 198.229 |
| Monoisotopic Mass | 198.09055 |
| SMILES | Cn1c(N)nc2c3cccnc3ccc21 |
| InChI | InChI=1S/C11H10N4/c1-15-9-5-4-8-7(3-2-6-13-8)10(9)14-11(15)12/h2-6H,1H3,(H2,12,14) |
| InChIKey | ARZWATDYIYAUTA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methyl-3H-imidazo[4,5-f]quinolin-2-amine (CHEBI:42725) has role carcinogenic agent (CHEBI:50903) |
| 3-methyl-3H-imidazo[4,5-f]quinolin-2-amine (CHEBI:42725) is a imidazoquinoline (CHEBI:38776) |
| IUPAC Name |
|---|
| 3-methyl-3H-imidazo[4,5-f]quinolin-2-amine |
| Synonym | Source |
|---|---|
| IQ | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| GIQ | PDBeChem |
| HMDB0029706 | HMDB |
| C19180 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5014055 | Reaxys |
| CAS:76180-96-6 | ChemIDplus |
| CAS:76180-96-6 | KEGG COMPOUND |
| Citations |
|---|