EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17805 - D-erythro-1-(imidazol-4-yl)glycerol 3-phosphate
| Formula | C6H11N2O6P |
| Net Charge | 0 |
| Average Mass | 238.136 |
| Monoisotopic Mass | 238.03547 |
| SMILES | O=P(O)(O)OC[C@@H](O)[C@@H](O)c1cncn1 |
| InChI | InChI=1S/C6H11N2O6P/c9-5(2-14-15(11,12)13)6(10)4-1-7-3-8-4/h1,3,5-6,9-10H,2H2,(H,7,8)(H2,11,12,13)/t5-,6+/m1/s1 |
| InChIKey | HFYBTHCYPKEDQQ-RITPCOANSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-erythro-1-(imidazol-4-yl)glycerol 3-phosphate (CHEBI:17805) has functional parent glycerol (CHEBI:17754) |
| D-erythro-1-(imidazol-4-yl)glycerol 3-phosphate (CHEBI:17805) has role Escherichia coli metabolite (CHEBI:76971) |
| D-erythro-1-(imidazol-4-yl)glycerol 3-phosphate (CHEBI:17805) is a sn-glycerol 3-phosphates (CHEBI:26706) |
| D-erythro-1-(imidazol-4-yl)glycerol 3-phosphate (CHEBI:17805) is a imidazoles (CHEBI:24780) |
| D-erythro-1-(imidazol-4-yl)glycerol 3-phosphate (CHEBI:17805) is conjugate acid of D-erythro-1-(imidazol-4-yl)glycerol 3-phosphate(2−) (CHEBI:58278) |
| Incoming Relation(s) |
| D-erythro-1-(imidazol-4-yl)glycerol 3-phosphate(2−) (CHEBI:58278) is conjugate base of D-erythro-1-(imidazol-4-yl)glycerol 3-phosphate (CHEBI:17805) |
| IUPAC Name |
|---|
| (2R,3S)-2,3-dihydroxy-3-(1H-imidazol-4-yl)propyl dihydrogen phosphate |
| Synonyms | Source |
|---|---|
| D-erythro-1-(Imidazol-4-yl)glycerol 3-phosphate | KEGG COMPOUND |
| D-erythro-Imidazole-glycerol 3-phosphate | KEGG COMPOUND |
| D-erythro-Imidazole-glycerol phosphate | KEGG COMPOUND |