EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19N7O6 |
| Net Charge | 0 |
| Average Mass | 441.404 |
| Monoisotopic Mass | 441.13968 |
| SMILES | Nc1nc(=O)c2nc(CNc3ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc3)cnc2n1 |
| InChI | InChI=1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1 |
| InChIKey | OVBPIULPVIDEAO-LBPRGKRZSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | DOI (10.1038/nbt.2488) | ||
| blood (UBERON:0000178) | PubMed (16277678) | ||
| cytoplasm (GO:0005737) | Article (Geigy Scientific Tables, 8th Rev edition, pp. 131. Edited by C. Lentner, West Cadwell, N.J.: Medical education Div., Ciba-Geigy Corp. Basel, Switzerland c1981-1992.) | ||
| urine (BTO:0001419) | Article (Geigy Scientific Tables, 8th Rev edition, pp. 130. Edited by C. Lentner, West Cadwell, N.J.: Medical education Div., Ciba-Geigy Corp. Basel, Switzerland c1981-1992.) | ||
| cerebrospinal fluid (UBERON:0001359) | PubMed (11959400) | ||
| Mus musculus (ncbitaxon:10090) | |||
| - | PubMed (19425150) | Source: BioModels - MODEL1507180067 | |
| - | MetaboLights (MTBLS292) | From MetaboLights | |
| Brassica napus (ncbitaxon:3708) | |||
| leaf lamina (BTO:0000719) | MetaboLights (MTBLS309) | From MetaboLights | |
| - | MetaboLights (MTBLS309) | From MetaboLights | |
| - | MetaboLights (MTBLS312) | From MetaboLights | |
| Micromonas pusilla (ncbitaxon:38833) | - | MetaboLights (MTBLS295) | From MetaboLights |
| Trypanosoma brucei (ncbitaxon:5691) | - | MetaboLights (MTBLS49) | From MetaboLights |
| Arabidopsis thaliana (ncbitaxon:3702) | cell suspension culture (BTO:0000221) | MetaboLights (MTBLS311) | From MetaboLights |
| Ruegeria pomeroyi (ncbitaxon:89184) | endometabolome | MetaboLights (MTBLS157) | From MetaboLights |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | nutrient A nutrient is a food component that an organism uses to survive and grow. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| folic acid (CHEBI:27470) has functional parent pteroic acid (CHEBI:38794) |
| folic acid (CHEBI:27470) has role human metabolite (CHEBI:77746) |
| folic acid (CHEBI:27470) has role mouse metabolite (CHEBI:75771) |
| folic acid (CHEBI:27470) has role nutrient (CHEBI:33284) |
| folic acid (CHEBI:27470) is a N-acyl-amino acid (CHEBI:51569) |
| folic acid (CHEBI:27470) is a folic acids (CHEBI:37445) |
| folic acid (CHEBI:27470) is conjugate acid of folate(2−) (CHEBI:62501) |
| Incoming Relation(s) |
| 4-aminofolic acid (CHEBI:22526) has functional parent folic acid (CHEBI:27470) |
| vitamin B complex (CHEBI:75782) has part folic acid (CHEBI:27470) |
| folate(2−) (CHEBI:62501) is conjugate base of folic acid (CHEBI:27470) |
| IUPAC Name |
|---|
| N-(4-{[(2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid |
| INNs | Source |
|---|---|
| folic acid | WHO MedNet |
| acidum folicum | WHO MedNet |
| acide folique | WHO MedNet |
| ácido fólico | WHO MedNet |
| Synonyms | Source |
|---|---|
| Folate | KEGG COMPOUND |
| pteroylglutamic acid | KEGG COMPOUND |
| N-pteroyl-L-glutamic acid | ChEBI |
| Folsäure | ChEBI |
| PteGlu | NIST Chemistry WebBook |
| vitamin M | ChemIDplus |
| Brand Names | Source |
|---|---|
| Folicet | KEGG DRUG |
| Acfol | ChemIDplus |
| Citations |
|---|