EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19N7O6 |
| Net Charge | 0 |
| Average Mass | 441.404 |
| Monoisotopic Mass | 441.13968 |
| SMILES | Nc1nc(=O)c2nc(CNc3ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc3)cnc2n1 |
| InChI | InChI=1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1 |
| InChIKey | OVBPIULPVIDEAO-LBPRGKRZSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | cell suspension culture (BTO:0000221) | MetaboLights (MTBLS311) | From MetaboLights |
| Brassica napus (ncbitaxon:3708) | |||
| leaf lamina (BTO:0000719) | MetaboLights (MTBLS309) | From MetaboLights | |
| - | MetaboLights (MTBLS309) | From MetaboLights | |
| - | MetaboLights (MTBLS312) | From MetaboLights | |
| Homo sapiens (ncbitaxon:9606) | |||
| cerebrospinal fluid (UBERON:0001359) | PubMed (11959400) | ||
| - | DOI (10.1038/nbt.2488) | ||
| cytoplasm (GO:0005737) | Article (Geigy Scientific Tables, 8th Rev edition, pp. 131. Edited by C. Lentner, West Cadwell, N.J.: Medical education Div., Ciba-Geigy Corp. Basel, Switzerland c1981-1992.) | ||
| blood (UBERON:0000178) | PubMed (16277678) | ||
| urine (BTO:0001419) | Article (Geigy Scientific Tables, 8th Rev edition, pp. 130. Edited by C. Lentner, West Cadwell, N.J.: Medical education Div., Ciba-Geigy Corp. Basel, Switzerland c1981-1992.) | ||
| Micromonas pusilla (ncbitaxon:38833) | - | MetaboLights (MTBLS295) | From MetaboLights |
| Mus musculus (ncbitaxon:10090) | |||
| - | MetaboLights (MTBLS292) | From MetaboLights | |
| - | PubMed (19425150) | Source: BioModels - MODEL1507180067 | |
| Ruegeria pomeroyi (ncbitaxon:89184) | endometabolome | MetaboLights (MTBLS157) | From MetaboLights |
| Trypanosoma brucei (ncbitaxon:5691) | - | MetaboLights (MTBLS49) | From MetaboLights |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). nutrient A nutrient is a food component that an organism uses to survive and grow. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| folic acid (CHEBI:27470) has functional parent pteroic acid (CHEBI:38794) |
| folic acid (CHEBI:27470) has role human metabolite (CHEBI:77746) |
| folic acid (CHEBI:27470) has role mouse metabolite (CHEBI:75771) |
| folic acid (CHEBI:27470) has role nutrient (CHEBI:33284) |
| folic acid (CHEBI:27470) is a N-acyl-amino acid (CHEBI:51569) |
| folic acid (CHEBI:27470) is a folic acids (CHEBI:37445) |
| folic acid (CHEBI:27470) is conjugate acid of folate(2−) (CHEBI:62501) |
| Incoming Relation(s) |
| 4-aminofolic acid (CHEBI:22526) has functional parent folic acid (CHEBI:27470) |
| vitamin B complex (CHEBI:75782) has part folic acid (CHEBI:27470) |
| folate(2−) (CHEBI:62501) is conjugate base of folic acid (CHEBI:27470) |
| IUPAC Name |
|---|
| N-(4-{[(2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid |
| INNs | Source |
|---|---|
| acide folique | WHO MedNet |
| ácido fólico | WHO MedNet |
| acidum folicum | WHO MedNet |
| folic acid | WHO MedNet |
| Synonyms | Source |
|---|---|
| (2S)-2-(4-{[(2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzamido)pentanedioic acid | IUPAC |
| N-pteroyl-L-glutamic acid | ChEBI |
| Folate | KEGG COMPOUND |
| Folsäure | ChEBI |
| N-[(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-glutamic acid | PDBeChem |
| PGA | NIST Chemistry WebBook |
| Brand Names | Source |
|---|---|
| Acfol | ChemIDplus |
| Folicet | KEGG DRUG |
| Citations |
|---|