EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14O5 |
| Net Charge | 0 |
| Average Mass | 166.173 |
| Monoisotopic Mass | 166.08412 |
| SMILES | C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[h1221m]/1/ |
| InChI | InChI=1S/C6H14O5/c1-3(8)5(10)6(11)4(9)2-7/h3-11H,2H2,1H3/t3-,4+,5+,6-/m0/s1 |
| InChIKey | SKCKOFZKJLZSFA-KCDKBNATSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Carum carvi (ncbitaxon:48032) | fruit (BTO:0000486) | PubMed (12377243) | |
| Myristica fragrans (ncbitaxon:51089) | fruit (BTO:0000486) | DOI (10.1016/j.lwt.2018.08.002) | Also found in arillus and seeds. |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-fucitol (CHEBI:42600) has role antibacterial agent (CHEBI:33282) |
| L-fucitol (CHEBI:42600) has role plant metabolite (CHEBI:76924) |
| L-fucitol (CHEBI:42600) is a fucitol (CHEBI:177915) |
| L-fucitol (CHEBI:42600) is enantiomer of D-fucitol (CHEBI:144571) |
| Incoming Relation(s) |
| D-fucitol (CHEBI:144571) is enantiomer of L-fucitol (CHEBI:42600) |
| IUPAC Name |
|---|
| 1-deoxy-D-galactitol |
| Synonyms | Source |
|---|---|
| (2R,3S,4R,5S)-hexane-1,2,3,4,5-pentol | IUPAC |
| 6-deoxy-L-galactitol | ChEBI |
| fucitol | PDBeChem |
| L-Fuc-ol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:13074-06-1 | ChemIDplus |
| Citations |
|---|