EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H33NO2 |
| Net Charge | 0 |
| Average Mass | 391.555 |
| Monoisotopic Mass | 391.25113 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)Nc2ccc(O)cc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C26H33NO2/c1-19(11-16-24-21(3)10-7-17-26(24,4)5)8-6-9-20(2)18-25(29)27-22-12-14-23(28)15-13-22/h6,8-9,11-16,18,28H,7,10,17H2,1-5H3,(H,27,29)/b9-6+,16-11+,19-8+,20-18+ |
| InChIKey | AKJHMTWEGVYYSE-FXILSDISSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxyphenyl retinamide (CHEBI:42588) has functional parent all-trans-retinoic acid (CHEBI:15367) |
| 4-hydroxyphenyl retinamide (CHEBI:42588) has role antineoplastic agent (CHEBI:35610) |
| 4-hydroxyphenyl retinamide (CHEBI:42588) has role antioxidant (CHEBI:22586) |
| 4-hydroxyphenyl retinamide (CHEBI:42588) is a monocarboxylic acid amide (CHEBI:29347) |
| 4-hydroxyphenyl retinamide (CHEBI:42588) is a retinoid (CHEBI:26537) |
| IUPAC Name |
|---|
| 15-[(4-hydroxyphenyl)amino]retinal |
| INNs | Source |
|---|---|
| fenretinida | ChemIDplus |
| fenretinide | KEGG DRUG |
| fenretinidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-HPR | DrugBank |
| 4-hydroxy(phenyl)retinamide | DrugBank |
| all-trans-4'-Hydroxyretinanilide | ChemIDplus |
| N-(4-hydroxyphenyl)all-trans retinamide | DrugBank |
| N-(4-HYDROXYPHENYL)ALL-TRANS RETINAMIDE | PDBeChem |
| N-(4-Hydroxyphenyl)retinamide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5769490 | Reaxys |
| CAS:65646-68-6 | ChemIDplus |
| Citations |
|---|