EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:42564 - α-D-fucose
| Formula | C6H12O5 |
| Net Charge | 0 |
| Average Mass | 164.157 |
| Monoisotopic Mass | 164.06847 |
| SMILES | C[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a2112m-1a_1-5]/1/ |
| InChI | InChI=1S/C6H12O5/c1-2-3(7)4(8)5(9)6(10)11-2/h2-10H,1H3/t2-,3+,4+,5-,6+/m1/s1 |
| InChIKey | SHZGCJCMOBCMKK-PHYPRBDBSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-D-fucose (CHEBI:42564) has role allergen (CHEBI:50904) |
| α-D-fucose (CHEBI:42564) is a D-fucopyranose (CHEBI:2179) |
| α-D-fucose (CHEBI:42564) is enantiomer of α-L-fucose (CHEBI:42548) |
| Incoming Relation(s) |
| dTDP-α-D-fucose (CHEBI:73950) has functional parent α-D-fucose (CHEBI:42564) |
| α-L-fucose (CHEBI:42548) is enantiomer of α-D-fucose (CHEBI:42564) |
| IUPAC Names |
|---|
| 6-deoxy-α-D-galactopyranose |
| α-D-fucopyranose |
| Synonyms | Source |
|---|---|
| ALPHA-D-FUCOSE | PDBeChem |
| α-D-Fuc | JCBN |
| α-D-Fucp | ChEBI |
| Citations |
|---|