EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8FN3O4 |
| Net Charge | 0 |
| Average Mass | 217.156 |
| Monoisotopic Mass | 217.04988 |
| SMILES | N[C@@H](Cn1cc(F)c(=O)nc1=O)C(=O)O |
| InChI | InChI=1S/C7H8FN3O4/c8-3-1-11(2-4(9)6(13)14)7(15)10-5(3)12/h1,4H,2,9H2,(H,13,14)(H,10,12,15)/t4-/m0/s1 |
| InChIKey | DBWPFHJYSTVBCZ-BYPYZUCNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | AMPA receptor agonist An agonist that selectively binds to and activates AMPA receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(5-fluorouracil-1-yl)-L-alanine (CHEBI:42549) has functional parent uracil (CHEBI:17568) |
| 3-(5-fluorouracil-1-yl)-L-alanine (CHEBI:42549) has role AMPA receptor agonist (CHEBI:64102) |
| 3-(5-fluorouracil-1-yl)-L-alanine (CHEBI:42549) is a L-alanine derivative (CHEBI:83943) |
| 3-(5-fluorouracil-1-yl)-L-alanine (CHEBI:42549) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 3-(5-fluorouracil-1-yl)-L-alanine (CHEBI:42549) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 3-(5-fluoro-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-L-alanine |
| Synonyms | Source |
|---|---|
| 2-AMINO-3-(5-FLUORO-2,4-DIOXO-3,4-DIHYDRO-2H-PYRIMIDIN-1-YL)-PROPIONIC ACID | PDBeChem |
| (2S)-2-amino-3-(5-fluoro-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)propanoic acid | DrugBank |
| 5-Fluorowillardiine | ChemIDplus |
| (S)-(−)-5-fluorowillardiine | ChEBI |
| (S)-alpha-Amino-5-fluoro-3,4-dihydro-2,4-dioxo-1(2H)-pyrimmidinepropanoic acid | ChemIDplus |
| (S)-F-Willardiine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 5-Fluorowillardiine | Wikipedia |
| C13671 | KEGG COMPOUND |
| DB02966 | DrugBank |
| FWD | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7817206 | Reaxys |
| CAS:140187-23-1 | ChemIDplus |
| Citations |
|---|