EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7O4P |
| Net Charge | 0 |
| Average Mass | 138.059 |
| Monoisotopic Mass | 138.00820 |
| SMILES | C[C@@H]1O[C@@H]1P(=O)(O)O |
| InChI | InChI=1S/C3H7O4P/c1-2-3(7-2)8(4,5)6/h2-3H,1H3,(H2,4,5,6)/t2-,3+/m0/s1 |
| InChIKey | YMDXZJFXQJVXBF-STHAYSLISA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.5.1.7 (UDP-N-acetylglucosamine 1-carboxyvinyltransferase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of UDP-N-acetylglucosamine 1-carboxyvinyltransferase (EC 2.5.1.7). antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fosfomycin (CHEBI:28915) has functional parent phosphonic acid (CHEBI:44976) |
| fosfomycin (CHEBI:28915) has role antibacterial agent (CHEBI:33282) |
| fosfomycin (CHEBI:28915) has role antiinfective agent (CHEBI:35441) |
| fosfomycin (CHEBI:28915) has role antimicrobial agent (CHEBI:33281) |
| fosfomycin (CHEBI:28915) has role antineoplastic agent (CHEBI:35610) |
| fosfomycin (CHEBI:28915) has role EC 2.5.1.7 (UDP-N-acetylglucosamine 1-carboxyvinyltransferase) inhibitor (CHEBI:78379) |
| fosfomycin (CHEBI:28915) is a epoxide (CHEBI:32955) |
| fosfomycin (CHEBI:28915) is a phosphonic acids (CHEBI:26069) |
| fosfomycin (CHEBI:28915) is conjugate acid of (1R,2S)-epoxypropylphosphonate(1−) (CHEBI:62247) |
| Incoming Relation(s) |
| (1R,2S)-epoxypropylphosphonate(1−) (CHEBI:62247) is conjugate base of fosfomycin (CHEBI:28915) |
| IUPAC Name |
|---|
| [(2R,3S)-3-methyloxiran-2-yl]phosphonic acid |
| INNs | Source |
|---|---|
| fosfomicina | ChemIDplus |
| fosfomycin | KEGG DRUG |
| fosfomycine | ChemIDplus |
| fosfomycinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1R-cis-(1,2-epoxypropyl)phosphonic acid | ChEBI |
| (-)-(1R,2S)-(1,2-Epoxypropyl)phosphonic acid | ChemIDplus |
| (1R,2S)-epoxypropylphosphonic acid | MetaCyc |
| (2R-cis)-(3-Methyloxiranyl)phosphonic acid | ChemIDplus |
| Calcium fosfomycin | ChEMBL |
| cis-(1R,2S)-epoxypropylphosphonic acid | MetaCyc |
| Brand Name | Source |
|---|---|
| Fosfocina | ChEMBL |
| Citations |
|---|