EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4250 - D-tagatofuranose 1,6-bisphosphate
| Formula | C6H14O12P2 |
| Net Charge | 0 |
| Average Mass | 340.114 |
| Monoisotopic Mass | 339.99605 |
| SMILES | O=P(O)(O)OC[C@H]1OC(O)(COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H14O12P2/c7-4-3(1-16-19(10,11)12)18-6(9,5(4)8)2-17-20(13,14)15/h3-5,7-9H,1-2H2,(H2,10,11,12)(H2,13,14,15)/t3-,4+,5+,6?/m1/s1 |
| InChIKey | RNBGYGVWRKECFJ-OEXCPVAWSA-N |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-tagatofuranose 1,6-bisphosphate (CHEBI:4250) has functional parent D-tagatofuranose (CHEBI:49088) |
| D-tagatofuranose 1,6-bisphosphate (CHEBI:4250) is a D-tagatose 1,6-bisphosphate (CHEBI:16743) |
| D-tagatofuranose 1,6-bisphosphate (CHEBI:4250) is conjugate acid of D-tagatofuranose 1,6-bisphosphate(4−) (CHEBI:58694) |
| Incoming Relation(s) |
| D-tagatofuranose 1,6-bisphosphate(4−) (CHEBI:58694) is conjugate base of D-tagatofuranose 1,6-bisphosphate (CHEBI:4250) |
| IUPAC Name |
|---|
| D-tagatofuranose 1,6-bis(dihydrogen phosphate) |
| Synonyms | Source |
|---|---|
| D-Tagatose 1,6-bisphosphate | KEGG COMPOUND |
| 1,6-di-O-phosphono-D-tagatofuranose | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| C03785 | KEGG COMPOUND |
| HMDB0006872 | HMDB |
| Citations |
|---|