EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | OCC1(O)OC[C@@H](O)[C@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,1,0/[ha112h-2x_2-6]/1/ |
| InChI | InChI=1S/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5,7-11H,1-2H2/t3-,4+,5+,6?/m1/s1 |
| InChIKey | LKDRXBCSQODPBY-OEXCPVAWSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. food component A physiological role played by any substance that is distributed in foodstuffs. It includes materials derived from plants or animals, such as vitamins or minerals, as well as environmental contaminants. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-tagatopyranose (CHEBI:4249) is a D-tagatose (CHEBI:16443) |
| Incoming Relation(s) |
| D-tagatopyranose 1-phosphate (CHEBI:138801) has functional parent D-tagatopyranose (CHEBI:4249) |
| α-D-tagatopyranose (CHEBI:49091) is a D-tagatopyranose (CHEBI:4249) |
| β-D-tagatopyranose (CHEBI:49092) is a D-tagatopyranose (CHEBI:4249) |
| IUPAC Name |
|---|
| D-tagatopyranose |
| Synonyms | Source |
|---|---|
| D-Tagatose | KEGG COMPOUND |
| lyxo-Hexulose | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00795 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5730129 | Beilstein |
| CAS:87-81-0 | KEGG COMPOUND |