EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N5O4 |
| Net Charge | 0 |
| Average Mass | 267.245 |
| Monoisotopic Mass | 267.09675 |
| SMILES | Nc1ncnc2c([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)nnc12 |
| InChI | InChI=1S/C10H13N5O4/c11-10-6-4(12-2-13-10)5(14-15-6)9-8(18)7(17)3(1-16)19-9/h2-3,7-9,16-18H,1H2,(H,14,15)(H2,11,12,13)/t3-,7-,8-,9+/m1/s1 |
| InChIKey | KBHMEHLJSZMEMI-KSYZLYKTSA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| formycin A (CHEBI:42452) has role antineoplastic agent (CHEBI:35610) |
| formycin A (CHEBI:42452) is a formycin (CHEBI:24088) |
| Incoming Relation(s) |
| N7-methylformycin A (CHEBI:42575) has functional parent formycin A (CHEBI:42452) |
| 6-methylformycin A (CHEBI:42495) has functional parent formycin A (CHEBI:42452) |
| formycin 3',5'-cyclic phosphate (CHEBI:131188) has functional parent formycin A (CHEBI:42452) |
| formycin A 5'-monophosphate (CHEBI:42506) has functional parent formycin A (CHEBI:42452) |
| IUPAC Name |
|---|
| (1S)-1-(7-amino-1H-pyrazolo[4,3-d]pyrimidin-3-yl)-1,4-anhydro-D-ribitol |
| Synonyms | Source |
|---|---|
| Formycin | ChemIDplus |
| FORMYCIN | PDBeChem |