EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O2 |
| Net Charge | 0 |
| Average Mass | 150.177 |
| Monoisotopic Mass | 150.06808 |
| SMILES | C=Cc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C9H10O2/c1-3-7-4-5-8(10)9(6-7)11-2/h3-6,10H,1H2,2H3 |
| InChIKey | YOMSJEATGXXYPX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methoxy-4-vinylphenol (CHEBI:42438) has role flavouring agent (CHEBI:35617) |
| 2-methoxy-4-vinylphenol (CHEBI:42438) has role pheromone (CHEBI:26013) |
| 2-methoxy-4-vinylphenol (CHEBI:42438) has role plant metabolite (CHEBI:76924) |
| 2-methoxy-4-vinylphenol (CHEBI:42438) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 4-ethenyl-2-methoxyphenol |
| Synonyms | Source |
|---|---|
| 2-(4-hydroxy-3-methoxyphenyl)ethene | ChEBI |
| 2M4VP | ChEBI |
| 4-ethenyl-2-methoxyphenol | NIST Chemistry WebBook |
| 4-hydroxy-3-methoxyphenylethene | ChEBI |
| 4-hydroxy-3-methoxystyrene | ChemIDplus |
| 4-hydroxy-3-methoxyvinylbenzene | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 2-methoxy-4-vinylphenol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 2-Methoxy-4-vinylphenol | Wikipedia |
| C17883 | KEGG COMPOUND |
| CPD-1072 | MetaCyc |
| DB03514 | DrugBank |
| HMDB0013744 | HMDB |
| HMDB0013819 | HMDB |
| Citations |
|---|