EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H33N9O15P2 |
| Net Charge | 0 |
| Average Mass | 785.557 |
| Monoisotopic Mass | 785.15713 |
| SMILES | Cc1cc2nc3c(=O)nc(=O)nc-3n(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)c2cc1C |
| InChI | InChI=1S/C27H33N9O15P2/c1-10-3-12-13(4-11(10)2)35(24-18(32-12)25(42)34-27(43)33-24)5-14(37)19(39)15(38)6-48-52(44,45)51-53(46,47)49-7-16-20(40)21(41)26(50-16)36-9-31-17-22(28)29-8-30-23(17)36/h3-4,8-9,14-16,19-21,26,37-41H,5-7H2,1-2H3,(H,44,45)(H,46,47)(H2,28,29,30)(H,34,42,43)/t14-,15+,16+,19-,20+,21+,26+/m0/s1 |
| InChIKey | VWWQXMAJTJZDQX-UYBVJOGSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. prosthetic group A tightly bound, specific nonpolypeptide unit in a protein determining and involved in its biological activity. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FAD (CHEBI:16238) has role Escherichia coli metabolite (CHEBI:76971) |
| FAD (CHEBI:16238) has role cofactor (CHEBI:23357) |
| FAD (CHEBI:16238) has role human metabolite (CHEBI:77746) |
| FAD (CHEBI:16238) has role mouse metabolite (CHEBI:75771) |
| FAD (CHEBI:16238) has role prosthetic group (CHEBI:26348) |
| FAD (CHEBI:16238) is a flavin adenine dinucleotide (CHEBI:24040) |
| FAD (CHEBI:16238) is a vitamin B2 (CHEBI:176838) |
| FAD (CHEBI:16238) is conjugate acid of FAD(3−) (CHEBI:57692) |
| Incoming Relation(s) |
| FAD(3−) (CHEBI:57692) is conjugate base of FAD (CHEBI:16238) |
| IUPAC Name |
|---|
| adenosine 5'-(3-{D-ribo-5-[7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl]-2,3,4-trihydroxypentyl} dihydrogen diphosphate) |
| Synonyms | Source |
|---|---|
| adenosine 5'-[3-(riboflavin-5'-yl) dihydrogen diphosphate] | ChEBI |
| Adenosine 5'-(trihydrogen pyrophosphate), 5'-5'-ester with riboflavine | ChemIDplus |
| FAD | KEGG COMPOUND |
| Flavin adenine dinucleotide | KEGG COMPOUND |
| FLAVIN-ADENINE DINUCLEOTIDE | PDBeChem |
| Riboflavin 5'-adenosine diphosphate | ChemIDplus |
| Citations |
|---|