EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24O2 |
| Net Charge | 0 |
| Average Mass | 320.432 |
| Monoisotopic Mass | 320.17763 |
| SMILES | CC[C@@H]1Cc2cc(O)ccc2C2=C1c1ccc(O)cc1C[C@H]2CC |
| InChI | InChI=1S/C22H24O2/c1-3-13-9-15-11-17(23)6-8-20(15)22-14(4-2)10-16-12-18(24)5-7-19(16)21(13)22/h5-8,11-14,23-24H,3-4,9-10H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | MASYAWHPJCQLSW-ZIAGYGMSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | estrogen receptor antagonist An antagonist at the estrogen receptor. estrogen receptor agonist An agonist at the estrogen receptor. |
| Applications: | estrogen receptor antagonist An antagonist at the estrogen receptor. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R,R)-5,11-diethyl-5,6,11,12-tetrahydro-2,8-chrysenediol (CHEBI:42371) has role estrogen receptor agonist (CHEBI:63951) |
| (R,R)-5,11-diethyl-5,6,11,12-tetrahydro-2,8-chrysenediol (CHEBI:42371) has role estrogen receptor antagonist (CHEBI:50792) |
| (R,R)-5,11-diethyl-5,6,11,12-tetrahydro-2,8-chrysenediol (CHEBI:42371) has role geroprotector (CHEBI:176497) |
| (R,R)-5,11-diethyl-5,6,11,12-tetrahydro-2,8-chrysenediol (CHEBI:42371) has role neuroprotective agent (CHEBI:63726) |
| (R,R)-5,11-diethyl-5,6,11,12-tetrahydro-2,8-chrysenediol (CHEBI:42371) is a carbotetracyclic compound (CHEBI:177332) |
| (R,R)-5,11-diethyl-5,6,11,12-tetrahydro-2,8-chrysenediol (CHEBI:42371) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (5R,11R)-5,11-diethyl-5,6,11,12-tetrahydrochrysene-2,8-diol |
| Synonyms | Source |
|---|---|
| (R,R)-5,11-cis-diethyl-5,6,11,12-tetrahydrochrysene-2,8-diol | PDBeChem |
| (R,R)-cis-diethyltetrahydro-2,8-chrysenediol | ChemIDplus |
| R,R-THC | ChemIDplus |
| (R,R)-THC | ChEBI |
| (R,R)-cis-diethyl tetrahydro-2,8-chrysenediol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| ETC | PDBeChem |
| 394097 | ChemSpider |
| (R,R)-Tetrahydrochrysene | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:221368-54-3 | ChemIDplus |
| Citations |
|---|