EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10N6O |
| Net Charge | 0 |
| Average Mass | 218.220 |
| Monoisotopic Mass | 218.09161 |
| SMILES | Nc1nnc(N)c1N=Nc1ccc(O)cc1 |
| InChI | InChI=1S/C9H10N6O/c10-8-7(9(11)15-14-8)13-12-5-1-3-6(16)4-2-5/h1-4,16H,(H5,10,11,14,15) |
| InChIKey | AYZRKFOEZQBUEA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.11.22 (cyclin-dependent kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cyclin-dependent kinase (EC 2.7.11.22). |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CAN-508 (CHEBI:42356) has role angiogenesis inhibitor (CHEBI:48422) |
| CAN-508 (CHEBI:42356) has role antineoplastic agent (CHEBI:35610) |
| CAN-508 (CHEBI:42356) has role apoptosis inducer (CHEBI:68495) |
| CAN-508 (CHEBI:42356) has role EC 2.7.11.22 (cyclin-dependent kinase) inhibitor (CHEBI:82665) |
| CAN-508 (CHEBI:42356) is a aromatic amine (CHEBI:33860) |
| CAN-508 (CHEBI:42356) is a monoazo compound (CHEBI:48959) |
| CAN-508 (CHEBI:42356) is a phenols (CHEBI:33853) |
| CAN-508 (CHEBI:42356) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| 4-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]phenol |
| Synonyms | Source |
|---|---|
| 4-[2-(3,5-diamino-1H-pyrazol-4-yl)diazen-1-yl]phenol | IUPAC |
| CAN 508 | ChEBI |
| CAN508 | ChEBI |
| CAY 10574 | ChEBI |
| CAY-10574 | ChEBI |
| CAY10574 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:140651-18-9 | ChemIDplus |
| Citations |
|---|