EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25NO5 |
| Net Charge | 0 |
| Average Mass | 359.422 |
| Monoisotopic Mass | 359.17327 |
| SMILES | [H][C@@]12C/C(=N\OCC(=O)O)c3cc(O)ccc3[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C20H25NO5/c1-20-7-6-13-12-3-2-11(22)8-15(12)17(21-26-10-19(24)25)9-14(13)16(20)4-5-18(20)23/h2-3,8,13-14,16,18,22-23H,4-7,9-10H2,1H3,(H,24,25)/b21-17+/t13-,14-,16+,18+,20+/m1/s1 |
| InChIKey | AWARIMYXKAIIGO-FIIMHDCBSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17β-estradiol 6-O-(carboxymethyl)oxime (CHEBI:42319) has functional parent 17β-estradiol (CHEBI:16469) |
| 17β-estradiol 6-O-(carboxymethyl)oxime (CHEBI:42319) has role epitope (CHEBI:53000) |
| 17β-estradiol 6-O-(carboxymethyl)oxime (CHEBI:42319) is a oxime O-ether (CHEBI:36816) |
| IUPAC Name |
|---|
| {[(3,17β-dihydroxyestra-1(10),2,4-trien-6-ylidene)amino]oxy}acetic acid |
| Synonyms | Source |
|---|---|
| ({[(6E,9beta,17beta)-3,17-dihydroxyestra-1,3,5(10)-trien-6-ylidene]amino}oxy)acetic acid | PDBeChem |
| ESTRADIOL-6 CARBOXYL-METHYL-OXIME | PDBeChem |
| Estradiol-6-cmo | ChemIDplus |
| Estradiol-6-(O-carboxymethyl)oxime | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2339969 | Reaxys |
| CAS:35048-47-6 | ChemIDplus |
| Citations |
|---|