EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15N2O14P3 |
| Net Charge | 0 |
| Average Mass | 468.141 |
| Monoisotopic Mass | 467.97361 |
| SMILES | O=c1ccn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)n1 |
| InChI | InChI=1S/C9H15N2O14P3/c12-5-3-8(11-2-1-7(13)10-9(11)14)23-6(5)4-22-27(18,19)25-28(20,21)24-26(15,16)17/h1-2,5-6,8,12H,3-4H2,(H,18,19)(H,20,21)(H,10,13,14)(H2,15,16,17)/t5-,6+,8+/m0/s1 |
| InChIKey | AHCYMLUZIRLXAA-SHYZEUOFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS129) | From MetaboLights |
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | |||
| prostate gland (UBERON:0002367) | PubMed (19212411) | ||
| - | DOI (10.1038/nbt.2488) | ||
| Mus musculus (ncbitaxon:10090) | |||
| - | PubMed (19425150) | Source: BioModels - MODEL1507180067 | |
| - | MetaboLights (MTBLS217) | From MetaboLights | |
| - | MetaboLights (MTBLS225) | From MetaboLights |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dUTP (CHEBI:17625) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| dUTP (CHEBI:17625) has role Escherichia coli metabolite (CHEBI:76971) |
| dUTP (CHEBI:17625) has role human metabolite (CHEBI:77746) |
| dUTP (CHEBI:17625) has role mouse metabolite (CHEBI:75771) |
| dUTP (CHEBI:17625) is a deoxyuridine phosphate (CHEBI:23641) |
| dUTP (CHEBI:17625) is a pyrimidine 2'-deoxyribonucleoside 5'-triphosphate (CHEBI:37043) |
| dUTP (CHEBI:17625) is conjugate acid of dUTP(3−) (CHEBI:58212) |
| Incoming Relation(s) |
| ethyl-dUTP (CHEBI:62903) has functional parent dUTP (CHEBI:17625) |
| dUTP(3−) (CHEBI:58212) is conjugate base of dUTP (CHEBI:17625) |
| IUPAC Name |
|---|
| 2'-deoxyuridine 5'-(tetrahydrogen triphosphate) |
| Synonyms | Source |
|---|---|
| 2'-deoxyuridine 5'-triphosphate | KEGG COMPOUND |
| 2'-deoxyuridine-5'-triphosphorate | HMDB |
| 2'-deoxyuridine triphosphate | ChEBI |
| 2'-deoxy-UTP | ChEBI |
| deoxyuridine-5'-triphosphate | DrugBank |
| deoxyuridine triphosphate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:102814-08-4 | ChemIDplus |
| Citations |
|---|