EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:4735 - ethylenediaminetetraacetic acid
| Formula | C10H16N2O8 |
| Net Charge | 0 |
| Average Mass | 292.244 |
| Monoisotopic Mass | 292.09067 |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C10H16N2O8/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | copper chelator A chelator that is any compound containing a ligand (typically organic) which is able to form a bond to a central copper atom at two or more points. calcium chelator A chelator that is any compound containing a ligand (typically organic) which is able to form a bond to a central calcium atom at two or more points. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antidote Any protective agent counteracting or neutralizing the action of poisons. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethylenediaminetetraacetic acid (CHEBI:4735) has role anticoagulant (CHEBI:50249) |
| ethylenediaminetetraacetic acid (CHEBI:4735) has role antidote (CHEBI:50247) |
| ethylenediaminetetraacetic acid (CHEBI:4735) has role antiinfective agent (CHEBI:35441) |
| ethylenediaminetetraacetic acid (CHEBI:4735) has role calcium chelator (CHEBI:232436) |
| ethylenediaminetetraacetic acid (CHEBI:4735) has role cardiovascular drug (CHEBI:35554) |
| ethylenediaminetetraacetic acid (CHEBI:4735) has role copper chelator (CHEBI:166831) |
| ethylenediaminetetraacetic acid (CHEBI:4735) has role geroprotector (CHEBI:176497) |
| ethylenediaminetetraacetic acid (CHEBI:4735) is a ethylenediamine derivative (CHEBI:31577) |
| ethylenediaminetetraacetic acid (CHEBI:4735) is a polyamino carboxylic acid (CHEBI:60892) |
| ethylenediaminetetraacetic acid (CHEBI:4735) is a tetracarboxylic acid (CHEBI:35742) |
| ethylenediaminetetraacetic acid (CHEBI:4735) is conjugate acid of EDTA(2−) (CHEBI:64755) |
| Incoming Relation(s) |
| EDTA(2−) (CHEBI:64755) is conjugate base of ethylenediaminetetraacetic acid (CHEBI:4735) |
| IUPAC Name |
|---|
| (ethane-1,2-diyldinitrilo)tetraacetic acid |
| INNs | Source |
|---|---|
| acide édétique | WHO MedNet |
| ácido edético | WHO MedNet |
| acidum edeticum | WHO MedNet |
| edetic acid | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2,2',2'',2'''-(ethane-1,2-diylbis(azanetriyl))tetraacetic acid | ChEBI |
| 2,2',2'',2'''-(ethane-1,2-diyldinitrilo)tetraacetic acid | PDBeChem |
| 2-([2-[bis(carboxymethyl)amino]ethyl](carboxymethyl)amino)acetic acid | ChEBI |
| {[-(BIS-CARBOXYMETHYL-AMINO)-ETHYL]-CARBOXYMETHYL-AMINO}-ACETIC ACID | PDBeChem |
| edathamil | ChEBI |
| edetic acid | ChEMBL |
| Brand Name | Source |
|---|---|
| Versene acid | ChEMBL |
| Citations |
|---|