EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24O3 |
| Net Charge | 0 |
| Average Mass | 288.387 |
| Monoisotopic Mass | 288.17254 |
| SMILES | [H][C@@]12CCc3cc(O)ccc3[C@@]1([H])CC[C@]1(C)[C@H](O)[C@H](O)C[C@@]21[H] |
| InChI | InChI=1S/C18H24O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)15(18)9-16(20)17(18)21/h3,5,8,13-17,19-21H,2,4,6-7,9H2,1H3/t13-,14-,15+,16-,17-,18+/m1/s1 |
| InChIKey | PROQIPRRNZUXQM-PNVOZDDCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | estrogen receptor agonist An agonist at the estrogen receptor. estrogen A hormone that stimulates or controls the development and maintenance of female sex characteristics in mammals by binding to oestrogen receptors. The oestrogens are named for their importance in the oestrous cycle. The oestrogens that occur naturally in the body, notably estrone, estradiol, estriol, and estetrol are steroids. Other compounds with oestrogenic activity are produced by plants (phytoestrogens) and fungi (mycoestrogens); synthetic compounds with oestrogenic activity are known as xenoestrogens. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17-epiestriol (CHEBI:42156) has parent hydride estrane (CHEBI:23966) |
| 17-epiestriol (CHEBI:42156) has role estrogen (CHEBI:50114) |
| 17-epiestriol (CHEBI:42156) has role estrogen receptor agonist (CHEBI:63951) |
| 17-epiestriol (CHEBI:42156) has role human urinary metabolite (CHEBI:84087) |
| 17-epiestriol (CHEBI:42156) is a 16α-hydroxy steroid (CHEBI:16799) |
| 17-epiestriol (CHEBI:42156) is a 17α-hydroxy steroid (CHEBI:35342) |
| 17-epiestriol (CHEBI:42156) is a 3-hydroxy steroid (CHEBI:36834) |
| Incoming Relation(s) |
| 17-epiestriol 16-O-(β-D-glucuronide) (CHEBI:137706) has functional parent 17-epiestriol (CHEBI:42156) |
| 17-epiestriol 17-O-(β-D-glucuronide) (CHEBI:137702) has functional parent 17-epiestriol (CHEBI:42156) |
| 17-epiestriol 3-O-(β-D-glucuronide) (CHEBI:137701) has functional parent 17-epiestriol (CHEBI:42156) |
| IUPAC Name |
|---|
| estra-1(10),2,4-triene-3,16α,17α-triol |
| Synonyms | Source |
|---|---|
| 1,3,5(10)-estratriene-3,16α,17α-triol | ChEBI |
| (16α,17α)-estra-1(10),2,4-triene-3,16,17-triol | IUPAC |
| 16α-hydroxy-17α-estradiol | ChEBI |
| 17-epiestriol | LIPID MAPS |
| 17α-estriol | ChemIDplus |
| 3,16α,17α-trihydroxy-1,3,5(10)-estratriene | ChEBI |
| UniProt Name | Source |
|---|---|
| 16α,17α-estriol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 17-epiestriol | Wikipedia |
| E3O | PDBeChem |
| HMDB0000356 | HMDB |
| LMST02010049 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2622737 | Reaxys |
| CAS:1228-72-4 | ChemIDplus |
| Citations |
|---|