EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16398 - D-threonine
| Formula | C4H9NO3 |
| Net Charge | 0 |
| Average Mass | 119.120 |
| Monoisotopic Mass | 119.05824 |
| SMILES | C[C@H](O)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3+/m0/s1 |
| InChIKey | AYFVYJQAPQTCCC-STHAYSLISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (15375647) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-threonine (CHEBI:16398) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| D-threonine (CHEBI:16398) is a D-α-amino acid (CHEBI:16733) |
| D-threonine (CHEBI:16398) is a threonine (CHEBI:26986) |
| D-threonine (CHEBI:16398) is conjugate acid of D-threoninate (CHEBI:32827) |
| D-threonine (CHEBI:16398) is conjugate base of D-threoninium (CHEBI:32828) |
| D-threonine (CHEBI:16398) is enantiomer of L-threonine (CHEBI:16857) |
| D-threonine (CHEBI:16398) is tautomer of D-threonine zwitterion (CHEBI:57757) |
| Incoming Relation(s) |
| D-threonine derivative (CHEBI:84188) has functional parent D-threonine (CHEBI:16398) |
| D-threoninium (CHEBI:32828) is conjugate acid of D-threonine (CHEBI:16398) |
| D-threoninate (CHEBI:32827) is conjugate base of D-threonine (CHEBI:16398) |
| L-threonine (CHEBI:16857) is enantiomer of D-threonine (CHEBI:16398) |
| D-threonin-O3-yl group (CHEBI:32831) is substituent group from D-threonine (CHEBI:16398) |
| D-threonine residue (CHEBI:30014) is substituent group from D-threonine (CHEBI:16398) |
| D-threonino group (CHEBI:32830) is substituent group from D-threonine (CHEBI:16398) |
| D-threonyl group (CHEBI:32829) is substituent group from D-threonine (CHEBI:16398) |
| D-threonine zwitterion (CHEBI:57757) is tautomer of D-threonine (CHEBI:16398) |
| IUPAC Name |
|---|
| D-threonine |
| Synonyms | Source |
|---|---|
| D-Threonine | KEGG COMPOUND |
| D-2-Amino-3-hydroxybutyric acid | KEGG COMPOUND |
| (2R,3S)-2-amino-3-hydroxybutanoic acid | IUPAC |
| D-THREONINE | PDBeChem |
| D-Threonin | ChEBI |
| D-2-Amino-3-hydroxybutyric acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C00820 | KEGG COMPOUND |
| DTH | PDBeChem |
| HMDB0013775 | HMDB |
| DB03700 | DrugBank |
| YMDB00802 | YMDB |
| ECMDB21519 | ECMDB |
| Registry Numbers | Sources |
|---|---|
| Gmelin:874136 | Gmelin |
| Beilstein:4656043 | Beilstein |
| Reaxys:1721643 | Reaxys |
| CAS:632-20-2 | KEGG COMPOUND |
| CAS:632-20-2 | ChemIDplus |
| Citations |
|---|