EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H34O5 |
| Net Charge | 0 |
| Average Mass | 390.520 |
| Monoisotopic Mass | 390.24062 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(C[C@@H](O)[C@@]4(C)[C@]3(O)CC[C@]4([H])C3=CC(=O)OC3)[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C23H34O5/c1-21-7-5-15(24)10-14(21)3-4-17-18(21)11-19(25)22(2)16(6-8-23(17,22)27)13-9-20(26)28-12-13/h9,14-19,24-25,27H,3-8,10-12H2,1-2H3/t14-,15+,16-,17-,18+,19-,21+,22+,23+/m1/s1 |
| InChIKey | SHIBSTMRCDJXLN-KCZCNTNESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| digoxigenin (CHEBI:42098) has parent hydride 5β-cardanolide (CHEBI:35542) |
| digoxigenin (CHEBI:42098) has role hapten (CHEBI:59174) |
| digoxigenin (CHEBI:42098) has role plant metabolite (CHEBI:76924) |
| digoxigenin (CHEBI:42098) is a 12β-hydroxy steroid (CHEBI:36847) |
| digoxigenin (CHEBI:42098) is a 14β-hydroxy steroid (CHEBI:36862) |
| digoxigenin (CHEBI:42098) is a 3β-hydroxy steroid (CHEBI:36836) |
| digoxigenin (CHEBI:42098) is a 3β-sterol (CHEBI:35348) |
| digoxigenin (CHEBI:42098) is conjugate acid of digoxigenin(1−) (CHEBI:145797) |
| Incoming Relation(s) |
| 20,22-dihydrodigoxigenin (CHEBI:71004) has functional parent digoxigenin (CHEBI:42098) |
| Dig-Cy5 (CHEBI:72459) has functional parent digoxigenin (CHEBI:42098) |
| digoxigenin 3,12-diacetate (CHEBI:63498) has functional parent digoxigenin (CHEBI:42098) |
| digoxigenin monodigitoxoside (CHEBI:63496) has functional parent digoxigenin (CHEBI:42098) |
| digoxigenin(1−) (CHEBI:145797) is conjugate base of digoxigenin (CHEBI:42098) |
| IUPAC Name |
|---|
| 3β,12β,14-trihydroxy-5β-card-20(22)-enolide |
| Manual Xrefs | Databases |
|---|---|
| CPD-22579 | MetaCyc |
| Digoxigenin | Wikipedia |
| DOG | PDBeChem |
| HMDB0060731 | HMDB |
| LMST01120008 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:1672-46-4 | ChemIDplus |
| Citations |
|---|