EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O7 |
| Net Charge | 0 |
| Average Mass | 196.155 |
| Monoisotopic Mass | 196.05830 |
| SMILES | O=C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[A1122h]/1/ |
| InChI | InChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2-,3-,4+,5+/m1/s1 |
| InChIKey | RGHNJXZEOKUKBD-MBMOQRBOSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-mannonic acid (CHEBI:33076) is a mannonic acid (CHEBI:21054) |
| D-mannonic acid (CHEBI:33076) is conjugate acid of D-mannonate (CHEBI:17767) |
| Incoming Relation(s) |
| N-acetyl-D-mannosaminouronic acid (CHEBI:73777) has functional parent D-mannonic acid (CHEBI:33076) |
| 2-amino-2-deoxy-D-mannonic acid (CHEBI:21056) has functional parent D-mannonic acid (CHEBI:33076) |
| D-mannopyranuronic acid (CHEBI:79047) is a D-mannonic acid (CHEBI:33076) |
| D-mannonate (CHEBI:17767) is conjugate base of D-mannonic acid (CHEBI:33076) |
| IUPAC Name |
|---|
| D-mannonic acid |
| Synonym | Source |
|---|---|
| D-Mannonate | KEGG COMPOUND |