EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H25NO2 |
| Net Charge | 0 |
| Average Mass | 215.337 |
| Monoisotopic Mass | 215.18853 |
| SMILES | NCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C12H25NO2/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h1-11,13H2,(H,14,15) |
| InChIKey | PBLZLIFKVPJDCO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas sp. (ncbitaxon:306) | - | PubMed (25912724) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-aminododecanoic acid (CHEBI:42025) has role bacterial metabolite (CHEBI:76969) |
| 12-aminododecanoic acid (CHEBI:42025) is a medium-chain fatty acid (CHEBI:59554) |
| 12-aminododecanoic acid (CHEBI:42025) is a ω-amino fatty acid (CHEBI:59758) |
| IUPAC Name |
|---|
| 12-aminododecanoic acid |
| Synonyms | Source |
|---|---|
| 12-amino-dodecanoic acid | LIPID MAPS |
| 12-Aminolauric acid | ChemIDplus |
| ω-aminolauric acid | ChEBI |
| ω-aminododecanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DOA | PDBeChem |
| LMFA01100005 | LIPID MAPS |
| JP2006271378 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:907502 | Reaxys |
| CAS:693-57-2 | ChemIDplus |
| Citations |
|---|