EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25N3O4S |
| Net Charge | 0 |
| Average Mass | 379.482 |
| Monoisotopic Mass | 379.15658 |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NCCCC[C@H](N)C(=O)O)cccc12 |
| InChI | InChI=1S/C18H25N3O4S/c1-21(2)16-10-5-8-14-13(16)7-6-11-17(14)26(24,25)20-12-4-3-9-15(19)18(22)23/h5-8,10-11,15,20H,3-4,9,12,19H2,1-2H3,(H,22,23)/t15-/m0/s1 |
| InChIKey | VQPRNSWQIAHPMS-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-dansyl-L-lysine (CHEBI:42024) has role epitope (CHEBI:53000) |
| N6-dansyl-L-lysine (CHEBI:42024) is a L-lysine derivative (CHEBI:25095) |
| N6-dansyl-L-lysine (CHEBI:42024) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| N6-dansyl-L-lysine (CHEBI:42024) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| N6-[5-(dimethylamino)naphthalene-1-sulfonyl]-L-lysine |
| Synonyms | Source |
|---|---|
| Dansyllysine | ChemIDplus |
| Dns-lysine | ChemIDplus |
| N6-{[5-(dimethylamino)-1-naphthyl]sulfonyl}-L-lysine | IUPAC |
| N(epsilon)-Dansyl-L-lysine | ChemIDplus |
| Citations |
|---|