EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H16O13P2 |
| Net Charge | 0 |
| Average Mass | 370.140 |
| Monoisotopic Mass | 370.00661 |
| SMILES | [H][C@]1([C@H](O)COP(=O)(O)O)OC(OP(=O)(O)O)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H16O13P2/c8-2(1-18-21(12,13)14)6-4(10)3(9)5(11)7(19-6)20-22(15,16)17/h2-11H,1H2,(H2,12,13,14)(H2,15,16,17)/t2-,3+,4+,5+,6-,7?/m1/s1 |
| InChIKey | LMTGTTLGDUACSJ-NNPWBXLPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-glycero-D-manno-heptose 1,7-bisphosphate (CHEBI:4188) has role Escherichia coli metabolite (CHEBI:76971) |
| D-glycero-D-manno-heptose 1,7-bisphosphate (CHEBI:4188) is a aldoheptose phosphate (CHEBI:35157) |
| D-glycero-D-manno-heptose 1,7-bisphosphate (CHEBI:4188) is conjugate acid of D-glycero-D-manno-heptose 1,7-bisphosphate(4−) (CHEBI:59957) |
| Incoming Relation(s) |
| D-glycero-α-D-manno-heptose 1,7-bisphosphate (CHEBI:60205) is a D-glycero-D-manno-heptose 1,7-bisphosphate (CHEBI:4188) |
| D-glycero-β-D-manno-heptose 1,7-bisphosphate (CHEBI:60206) is a D-glycero-D-manno-heptose 1,7-bisphosphate (CHEBI:4188) |
| D-glycero-D-manno-heptose 1,7-bisphosphate(4−) (CHEBI:59957) is conjugate base of D-glycero-D-manno-heptose 1,7-bisphosphate (CHEBI:4188) |
| IUPAC Name |
|---|
| (5R)-5-[(1R)-1-hydroxy-2-(phosphonooxy)ethyl]-1-O-phosphono-D-lyxopyranose |