EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10N2O3 |
| Net Charge | 0 |
| Average Mass | 146.146 |
| Monoisotopic Mass | 146.06914 |
| SMILES | NC(=O)CC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m1/s1 |
| InChIKey | ZDXPYRJPNDTMRX-GSVOUGTGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-glutamine (CHEBI:17061) has role mouse metabolite (CHEBI:75771) |
| D-glutamine (CHEBI:17061) is a D-α-amino acid (CHEBI:16733) |
| D-glutamine (CHEBI:17061) is a glutamine (CHEBI:28300) |
| D-glutamine (CHEBI:17061) is conjugate acid of D-glutaminate (CHEBI:32672) |
| D-glutamine (CHEBI:17061) is conjugate base of D-glutaminium (CHEBI:32673) |
| D-glutamine (CHEBI:17061) is enantiomer of L-glutamine (CHEBI:18050) |
| D-glutamine (CHEBI:17061) is tautomer of D-glutamine zwitterion (CHEBI:58000) |
| Incoming Relation(s) |
| D-glutamine derivative (CHEBI:83987) has functional parent D-glutamine (CHEBI:17061) |
| D-glutaminium (CHEBI:32673) is conjugate acid of D-glutamine (CHEBI:17061) |
| D-glutaminate (CHEBI:32672) is conjugate base of D-glutamine (CHEBI:17061) |
| L-glutamine (CHEBI:18050) is enantiomer of D-glutamine (CHEBI:17061) |
| N2-D-glutamino group (CHEBI:32675) is substituent group from D-glutamine (CHEBI:17061) |
| N5-D-glutamino group (CHEBI:32676) is substituent group from D-glutamine (CHEBI:17061) |
| D-glutamine residue (CHEBI:48097) is substituent group from D-glutamine (CHEBI:17061) |
| D-glutaminyl group (CHEBI:32674) is substituent group from D-glutamine (CHEBI:17061) |
| D-glutamine zwitterion (CHEBI:58000) is tautomer of D-glutamine (CHEBI:17061) |
| IUPAC Name |
|---|
| D-glutamine |
| Synonyms | Source |
|---|---|
| (2R)-2,5-diamino-5-oxopentanoic acid | IUPAC |
| (2R)-2-amino-4-carbamoylbutanoic acid | JCBN |
| D-2-Aminoglutaramic acid | KEGG COMPOUND |
| D-Glutamine | KEGG COMPOUND |
| DGN | PDBeChem |
| (R)-2,5-diamino-5-oxopentanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00819 | KEGG COMPOUND |
| DB02174 | DrugBank |
| DGN | PDBeChem |
| ECMDB03423 | ECMDB |
| GLUTAMIDE | MetaCyc |
| HMDB0003423 | HMDB |
| WO2011109119 | Patent |
| YMDB00990 | YMDB |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1318700 | Gmelin |
| Reaxys:1723796 | Reaxys |
| CAS:5959-95-5 | KEGG COMPOUND |
| CAS:5959-95-5 | ChemIDplus |
| Citations |
|---|