EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10N2O3 |
| Net Charge | 0 |
| Average Mass | 146.146 |
| Monoisotopic Mass | 146.06914 |
| SMILES | NC(=O)CCC(N)C(=O)O |
| InChI | InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10) |
| InChIKey | ZDXPYRJPNDTMRX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | PubMed (1684022) | |
| Daphnia magna (ncbitaxon:35525) | - | PubMed (20117838) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21886157) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glutamine (CHEBI:28300) has part 3-amino-3-oxopropyl group (CHEBI:50331) |
| glutamine (CHEBI:28300) has role fundamental metabolite (CHEBI:78675) |
| glutamine (CHEBI:28300) is a polar amino acid (CHEBI:26167) |
| glutamine (CHEBI:28300) is a α-amino acid (CHEBI:33704) |
| glutamine (CHEBI:28300) is conjugate acid of glutaminate (CHEBI:32678) |
| glutamine (CHEBI:28300) is conjugate base of glutaminium (CHEBI:32679) |
| Incoming Relation(s) |
| N2-phenylacetylglutamine (CHEBI:8087) has functional parent glutamine (CHEBI:28300) |
| glutamine derivative (CHEBI:70813) has functional parent glutamine (CHEBI:28300) |
| D-glutamine (CHEBI:17061) is a glutamine (CHEBI:28300) |
| L-glutamine (CHEBI:18050) is a glutamine (CHEBI:28300) |
| glutaminium (CHEBI:32679) is conjugate acid of glutamine (CHEBI:28300) |
| glutaminate (CHEBI:32678) is conjugate base of glutamine (CHEBI:28300) |
| N2-glutamino group (CHEBI:21816) is substituent group from glutamine (CHEBI:28300) |
| N5-glutamino group (CHEBI:21847) is substituent group from glutamine (CHEBI:28300) |
| glutamine residue (CHEBI:32677) is substituent group from glutamine (CHEBI:28300) |
| glutaminyl group (CHEBI:24320) is substituent group from glutamine (CHEBI:28300) |
| IUPAC Name |
|---|
| glutamine |
| Synonyms | Source |
|---|---|
| 2,5-diamino-5-oxopentanoic acid | IUPAC |
| 2-amino-4-carbamoylbutanoic acid | JCBN |
| 2-Aminoglutaramic acid | KEGG COMPOUND |
| glutamic acid γ-amide | ChEBI |
| Glutamin | ChEBI |
| Glutamine | KEGG COMPOUND |