EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8O2S2 |
| Net Charge | 0 |
| Average Mass | 152.240 |
| Monoisotopic Mass | 151.99657 |
| SMILES | O[C@@H]1CSSC[C@H]1O |
| InChI | InChI=1S/C4H8O2S2/c5-3-1-7-8-2-4(3)6/h3-6H,1-2H2/t3-,4-/m1/s1 |
| InChIKey | YPGMOWHXEQDBBV-QWWZWVQMSA-N |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4S,5S)-1,2-dithiane-4,5-diol (CHEBI:41837) is a trans-1,2-dithiane-4,5-diol (CHEBI:16912) |
| (4S,5S)-1,2-dithiane-4,5-diol (CHEBI:41837) is enantiomer of (4R,5R)-1,2-dithiane-4,5-diol (CHEBI:42147) |
| Incoming Relation(s) |
| (4R,5R)-1,2-dithiane-4,5-diol (CHEBI:42147) is enantiomer of (4S,5S)-1,2-dithiane-4,5-diol (CHEBI:41837) |
| IUPAC Name |
|---|
| (4S,5S)-1,2-dithiane-4,5-diol |
| UniProt Name | Source |
|---|---|
| oxidized dithiothreitol | UniProt |