EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N3O13P3 |
| Net Charge | 0 |
| Average Mass | 467.157 |
| Monoisotopic Mass | 466.98960 |
| SMILES | Nc1ccn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)n1 |
| InChI | InChI=1S/C9H16N3O13P3/c10-7-1-2-12(9(14)11-7)8-3-5(13)6(23-8)4-22-27(18,19)25-28(20,21)24-26(15,16)17/h1-2,5-6,8,13H,3-4H2,(H,18,19)(H,20,21)(H2,10,11,14)(H2,15,16,17)/t5-,6+,8+/m0/s1 |
| InChIKey | RGWHQCVHVJXOKC-SHYZEUOFSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | DOI (10.1038/nbt.2488) | ||
| blood (UBERON:0000178) | PubMed (7877593) | ||
| Escherichia coli (ncbitaxon:562) | |||
| - | PubMed (21988831) | ||
| whole organism (UBERON:0000468) | MetaboLights (MTBLS229) | From MetaboLights | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dCTP (CHEBI:16311) has role Escherichia coli metabolite (CHEBI:76971) |
| dCTP (CHEBI:16311) has role human metabolite (CHEBI:77746) |
| dCTP (CHEBI:16311) has role mouse metabolite (CHEBI:75771) |
| dCTP (CHEBI:16311) is a 2'-deoxycytidine phosphate (CHEBI:37092) |
| dCTP (CHEBI:16311) is a pyrimidine 2'-deoxyribonucleoside 5'-triphosphate (CHEBI:37043) |
| dCTP (CHEBI:16311) is conjugate acid of dCTP(3−) (CHEBI:57724) |
| Incoming Relation(s) |
| 5-iododeoxycytidine triphosphate (CHEBI:86351) has functional parent dCTP (CHEBI:16311) |
| dCTP(3−) (CHEBI:57724) is conjugate base of dCTP (CHEBI:16311) |
| IUPAC Name |
|---|
| 2'-deoxycytidine 5'-(tetrahydrogen triphosphate) |
| Synonyms | Source |
|---|---|
| dCTP | KEGG COMPOUND |
| deoxycytidine 5'-triphosphate | KEGG COMPOUND |
| deoxycytidine triphosphate | KEGG COMPOUND |
| 2'-deoxycytidine 5'-triphosphate | KEGG COMPOUND |
| 2'-deoxycytidine triphosphate | ChEBI |
| 2'-deoxy-CTP | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00458 | KEGG COMPOUND |
| DB03258 | DrugBank |
| DCP | PDBeChem |
| 58601 | ChemSpider |
| HMDB0000998 | HMDB |
| Deoxycytidine_triphosphate | Wikipedia |
| FDB022359 | FooDB |
| Registry Numbers | Sources |
|---|---|
| CAS:2056-98-6 | ChemIDplus |
| Citations |
|---|