EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5NO7S |
| Net Charge | 0 |
| Average Mass | 235.173 |
| Monoisotopic Mass | 234.97867 |
| SMILES | O=[N+]([O-])c1ccc(O)c(OS(=O)(=O)O)c1 |
| InChI | InChI=1S/C6H5NO7S/c8-5-2-1-4(7(9)10)3-6(5)14-15(11,12)13/h1-3,8H,(H,11,12,13) |
| InChIKey | XMCCOOONGGUOLA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | chromogenic compound Colourless, endogenous or exogenous pigment precursors that may be transformed by biological mechanisms into coloured compounds. They are used in biochemical assays and in diagnosis as indicators, particularly in the form of enzyme substrates. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-5-nitrophenyl hydrogen sulfate (CHEBI:41733) has functional parent 4-nitrocatechol (CHEBI:16318) |
| 2-hydroxy-5-nitrophenyl hydrogen sulfate (CHEBI:41733) has role chromogenic compound (CHEBI:75050) |
| 2-hydroxy-5-nitrophenyl hydrogen sulfate (CHEBI:41733) is a 4-nitrophenols (CHEBI:88306) |
| 2-hydroxy-5-nitrophenyl hydrogen sulfate (CHEBI:41733) is a aryl sulfate (CHEBI:37919) |
| IUPAC Name |
|---|
| 2-hydroxy-5-nitrophenyl hydrogen sulfate |
| Synonyms | Source |
|---|---|
| 2-hydroxy-5-nitrophenyl sulfate | ChemIDplus |
| 4-nitrocatechol sulfate | ChemIDplus |
| p-nitrocatechol sulfate | ChemIDplus |
| N,4-DIHYDROXY-N-OXO-3-(SULFOOXY)BENZENAMINIUM | PDBeChem |
| sulfuric acid mono-(2-hydroxy-5-nitro-phenyl ester) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CSN | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2058143 | Reaxys |
| CAS:10485-66-2 | ChemIDplus |