EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO4S |
| Net Charge | 0 |
| Average Mass | 193.224 |
| Monoisotopic Mass | 193.04088 |
| SMILES | CSCC[C@H](NC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H11NO4S/c1-12-3-2-4(5(8)9)7-6(10)11/h4,7H,2-3H2,1H3,(H,8,9)(H,10,11)/t4-/m0/s1 |
| InChIKey | LWQBAQJPCYBWJQ-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-carboxy-L-methionine (CHEBI:41696) is a L-methionine derivative (CHEBI:84121) |
| N-carboxy-L-methionine (CHEBI:41696) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| N-carboxy-L-methionine (CHEBI:41696) is conjugate acid of N-carboxy-L-methionine(2−) (CHEBI:61923) |
| Incoming Relation(s) |
| N-carboxy-L-methionine(2−) (CHEBI:61923) is conjugate base of N-carboxy-L-methionine (CHEBI:41696) |
| N-carboxy-L-methionine residue (CHEBI:61924) is substituent group from N-carboxy-L-methionine (CHEBI:41696) |
| IUPAC Name |
|---|
| N-carboxy-L-methionine |
| Synonym | Source |
|---|---|
| N-carboxymethionine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CXM | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6324600 | Reaxys |