EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20N2O4 |
| Net Charge | 0 |
| Average Mass | 352.390 |
| Monoisotopic Mass | 352.14231 |
| SMILES | CCc1cc(-c2nnc(C)c2-c2ccc3c(c2)OCCO3)c(O)cc1O |
| InChI | InChI=1S/C20H20N2O4/c1-3-12-8-14(16(24)10-15(12)23)20-19(11(2)21-22-20)13-4-5-17-18(9-13)26-7-6-25-17/h4-5,8-10,23-24H,3,6-7H2,1-2H3,(H,21,22) |
| InChIKey | OWPMENVYXDJDOW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CCT-018159 (CHEBI:41656) has role antineoplastic agent (CHEBI:35610) |
| CCT-018159 (CHEBI:41656) has role apoptosis inducer (CHEBI:68495) |
| CCT-018159 (CHEBI:41656) has role Hsp90 inhibitor (CHEBI:63962) |
| CCT-018159 (CHEBI:41656) is a benzodioxine (CHEBI:64096) |
| CCT-018159 (CHEBI:41656) is a pyrazoles (CHEBI:26410) |
| CCT-018159 (CHEBI:41656) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methyl-1H-pyrazol-5-yl]-6-ethylbenzene-1,3-diol |
| Synonyms | Source |
|---|---|
| 4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methylpyrazol-5-yl]-6-ethylbenzene-1,3-diol | ChEBI |
| CCT018159 | ChEBI |
| CCT 018159 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:25310995 | Reaxys |
| CAS:171009-07-7 | ChemIDplus |
| Citations |
|---|