EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O2 |
| Net Charge | 0 |
| Average Mass | 400.647 |
| Monoisotopic Mass | 400.33413 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CC[C@]1([H])OC1(C)C |
| InChI | InChI=1S/C27H44O2/c1-17(6-11-24-25(2,3)29-24)21-9-10-22-20-8-7-18-16-19(28)12-14-26(18,4)23(20)13-15-27(21,22)5/h7,17,19-24,28H,6,8-16H2,1-5H3/t17-,19+,20+,21-,22+,23+,24+,26+,27-/m1/s1 |
| InChIKey | OSENKJZWYQXHBN-XVYZBDJZSA-N |
| Roles Classification |
|---|
| Biological Role: | liver X receptor agonist Any compound that acts as an agonist towards the liver X receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 24(S),25-epoxycholesterol (CHEBI:41633) has functional parent desmosterol (CHEBI:17737) |
| 24(S),25-epoxycholesterol (CHEBI:41633) has role liver X receptor agonist (CHEBI:86029) |
| 24(S),25-epoxycholesterol (CHEBI:41633) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| 24(S),25-epoxycholesterol (CHEBI:41633) is a cholestanoid (CHEBI:50401) |
| 24(S),25-epoxycholesterol (CHEBI:41633) is a epoxy steroid (CHEBI:145217) |
| IUPAC Name |
|---|
| (24S)-24,25-epoxycholest-5-en-3β-ol |
| Synonyms | Source |
|---|---|
| 24,25-epoxy-cholesterol | LIPID MAPS |
| (24S)-24,25-epoxycholesterol | ChEBI |
| 24S,25-epoxy-cholest-5-en-3β-ol | LIPID MAPS |
| 24S,25-epoxy-cholesterol | LIPID MAPS |
| 24(S),25-EC | ChEBI |
| (3β,24S)-24,25-epoxycholest-5-en-3-ol | IUPAC |
| UniProt Name | Source |
|---|---|
| (24S)-25-epoxycholesterol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C15632 | KEGG COMPOUND |
| CO1 | PDBeChem |
| LMST01010012 | LIPID MAPS |
| LSM-5712 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5765150 | Reaxys |
| CAS:77058-74-3 | KEGG COMPOUND |
| Citations |
|---|