EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7NO3S |
| Net Charge | 0 |
| Average Mass | 137.160 |
| Monoisotopic Mass | 137.01466 |
| SMILES | [H]S(=O)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C3H7NO3S/c4-2(1-8-7)3(5)6/h2,8H,1,4H2,(H,5,6)/t2-/m0/s1 |
| InChIKey | BHLMCOCHAVMHLD-REOHCLBHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-oxy-L-cysteine (CHEBI:41630) is a L-cysteine derivative (CHEBI:83824) |
| S-oxy-L-cysteine (CHEBI:41630) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| S-oxy-L-cysteine (CHEBI:41630) is tautomer of S-hydroxy-L-cysteine (CHEBI:41710) |
| Incoming Relation(s) |
| S-oxy-L-cysteine residue (CHEBI:61962) is substituent group from S-oxy-L-cysteine (CHEBI:41630) |
| S-hydroxy-L-cysteine (CHEBI:41710) is tautomer of S-oxy-L-cysteine (CHEBI:41630) |
| IUPAC Name |
|---|
| 3-(oxido-λ4-sulfanyl)-L-alanine |
| Synonyms | Source |
|---|---|
| S-oxocysteine | ChEBI |
| S-oxo-L-cysteine | ChEBI |
| S-oxycysteine | ChEBI |
| cysteine sulphoxide | ChEBI |
| cysteine sulfoxide | ChEBI |
| L-cysteine sulfoxide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6767124 | Reaxys |